|
Name |
Phenethyl anthranilate
|
Molecular Formula | C15H15NO2 | |
IUPAC Name* |
2-phenylethyl 2-aminobenzoate
|
|
SMILES |
C1=CC=C(C=C1)CCOC(=O)C2=CC=CC=C2N
|
|
InChI |
InChI=1S/C15H15NO2/c16-14-9-5-4-8-13(14)15(17)18-11-10-12-6-2-1-3-7-12/h1-9H,10-11,16H2
|
|
InChIKey |
PXWNBAGCFUDYBE-UHFFFAOYSA-N
|
|
Synonyms |
PHENETHYL ANTHRANILATE; 2-Phenylethyl 2-aminobenzoate; 133-18-6; 2-Phenylethyl anthranilate; Phenylethyl anthranilate; Benzoic acid, 2-amino-, 2-phenylethyl ester; Benzylcarbinyl anthranilate; Anthranilic acid, phenethyl ester; 2-Phenylethyl o-aminobenzoate; 2-Phenylethyl-o-aminobenzoate; beta-Phenethyl o-aminobenzoate; beta-Phenethyl-o-aminobenzoate; FEMA No. 2859; beta-Phenylethyl anthranilate; NSC 66441; Benzyl carbinyl anthranilate; MLS002693572; 8HBK71OD81; .beta.-Phenethyl-o-aminobenzoate; Anthranilic acid, phenylethyl ester; NSC-66441; DSSTox_CID_5861; DSSTox_RID_77951; DSSTox_GSID_25861; CAS-133-18-6; SMR001307335; CCRIS 4695; phenethyl 2-aminobenzoate; EINECS 205-098-0; UNII-8HBK71OD81; AI3-36132; Benzoic acid, 2-amino-,2-phenylethyl ester; WLN: ZR BVO2R; beta -phenylethyl anthranilate; MLS002303059; SCHEMBL446803; Anthanilic acid phenethyl ester; .beta.-Phenylethyl anthranilate; beta -phenethyl-O-aminobenzoate; CHEMBL1488668; DTXSID5025861; .beta.-Phenethyl o-aminobenzoate; FEMA 2859; CHEBI:191913; HMS3039J07; NSC66441; ZINC1693901; Tox21_202175; Tox21_303500; PHENETHYL ANTHRANILATE [FHFI]; PHENYLETHYL ANTHRANILATE [FCC]; AKOS010555379; Phenethyl anthranilate, >=98%, FCC; NCGC00091901-01; NCGC00091901-02; NCGC00257318-01; NCGC00259724-01; DS-000794; Q27270507
|
|
CAS | 133-18-6 | |
PubChem CID | 8615 | |
ChEMBL ID | CHEMBL1488668 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 241.28 | ALogp: | 4.2 |
HBD: | 1 | HBA: | 3 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 52.3 | Aromatic Rings: | 2 |
Heavy Atoms: | 18 | QED Weighted: | 0.658 |
Caco-2 Permeability: | -4.627 | MDCK Permeability: | 0.00003340 |
Pgp-inhibitor: | 0.084 | Pgp-substrate: | 0.007 |
Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.7 |
30% Bioavailability (F30%): | 0.992 |
Blood-Brain-Barrier Penetration (BBB): | 0.661 | Plasma Protein Binding (PPB): | 94.92% |
Volume Distribution (VD): | 1.157 | Fu: | 3.88% |
CYP1A2-inhibitor: | 0.986 | CYP1A2-substrate: | 0.232 |
CYP2C19-inhibitor: | 0.969 | CYP2C19-substrate: | 0.083 |
CYP2C9-inhibitor: | 0.878 | CYP2C9-substrate: | 0.131 |
CYP2D6-inhibitor: | 0.795 | CYP2D6-substrate: | 0.678 |
CYP3A4-inhibitor: | 0.85 | CYP3A4-substrate: | 0.218 |
Clearance (CL): | 11.478 | Half-life (T1/2): | 0.358 |
hERG Blockers: | 0.196 | Human Hepatotoxicity (H-HT): | 0.031 |
Drug-inuced Liver Injury (DILI): | 0.303 | AMES Toxicity: | 0.087 |
Rat Oral Acute Toxicity: | 0.013 | Maximum Recommended Daily Dose: | 0.033 |
Skin Sensitization: | 0.791 | Carcinogencity: | 0.57 |
Eye Corrosion: | 0.018 | Eye Irritation: | 0.987 |
Respiratory Toxicity: | 0.271 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001737 | 0.588 | D0G1VX | 0.547 | ||||
ENC003208 | 0.562 | D0J2KV | 0.459 | ||||
ENC000077 | 0.547 | D0KS6W | 0.446 | ||||
ENC000216 | 0.509 | D0L5PO | 0.408 | ||||
ENC000160 | 0.491 | D0T5UL | 0.405 | ||||
ENC000597 | 0.483 | D04DXN | 0.405 | ||||
ENC001523 | 0.479 | D02IHW | 0.400 | ||||
ENC004815 | 0.468 | D0Y0JH | 0.400 | ||||
ENC001805 | 0.452 | D07HQC | 0.395 | ||||
ENC001449 | 0.446 | D0J5RN | 0.395 |