|
Name |
5,7-Dimethoxy-4-phenylchromen-2-one
|
Molecular Formula | C17H14O4 | |
IUPAC Name* |
5,7-dimethoxy-4-phenylchromen-2-one
|
|
SMILES |
COC1=CC2=C(C(=CC(=O)O2)C3=CC=CC=C3)C(=C1)OC
|
|
InChI |
InChI=1S/C17H14O4/c1-19-12-8-14(20-2)17-13(11-6-4-3-5-7-11)10-16(18)21-15(17)9-12/h3-10H,1-2H3
|
|
InChIKey |
YYLAUZVFWOZLCG-UHFFFAOYSA-N
|
|
Synonyms |
5,7-Dimethoxy-4-phenyl-chromen-2-one; MLS001049018; 5,7-dimethoxy-4-phenylcoumarin; SMR000387032; 5,7-dimethoxy-4-phenylchromen-2-one; 5,7-dimethoxy-4-phenyl-2H-chromen-2-one; Oprea1_507583; Oprea1_533635; cid_701671; IFLab1_001521; 4-Phenyl-5,7-dimethoxycoumarin; CHEMBL1375826; BDBM69317; ZINC82856; 5,7-dimethoxy-4-phenyl-coumarin; HMS1416F03; HMS2268K15; STK005022; AKOS001629701; 26952-92-1; 5,7-dimethoxy-4-phenyl-1-benzopyran-2-one; AB00600865-08; SR-01000442929; SR-01000442929-1
|
|
CAS | NA | |
PubChem CID | 701671 | |
ChEMBL ID | CHEMBL1375826 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 282.29 | ALogp: | 3.0 |
HBD: | 0 | HBA: | 4 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 44.8 | Aromatic Rings: | 3 |
Heavy Atoms: | 21 | QED Weighted: | 0.675 |
Caco-2 Permeability: | -4.767 | MDCK Permeability: | 0.00003620 |
Pgp-inhibitor: | 0.991 | Pgp-substrate: | 0.019 |
Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.154 |
30% Bioavailability (F30%): | 0.998 |
Blood-Brain-Barrier Penetration (BBB): | 0.139 | Plasma Protein Binding (PPB): | 91.81% |
Volume Distribution (VD): | 0.845 | Fu: | 4.49% |
CYP1A2-inhibitor: | 0.973 | CYP1A2-substrate: | 0.962 |
CYP2C19-inhibitor: | 0.943 | CYP2C19-substrate: | 0.178 |
CYP2C9-inhibitor: | 0.777 | CYP2C9-substrate: | 0.92 |
CYP2D6-inhibitor: | 0.626 | CYP2D6-substrate: | 0.921 |
CYP3A4-inhibitor: | 0.784 | CYP3A4-substrate: | 0.331 |
Clearance (CL): | 10.016 | Half-life (T1/2): | 0.445 |
hERG Blockers: | 0.219 | Human Hepatotoxicity (H-HT): | 0.207 |
Drug-inuced Liver Injury (DILI): | 0.817 | AMES Toxicity: | 0.544 |
Rat Oral Acute Toxicity: | 0.046 | Maximum Recommended Daily Dose: | 0.521 |
Skin Sensitization: | 0.565 | Carcinogencity: | 0.21 |
Eye Corrosion: | 0.052 | Eye Irritation: | 0.953 |
Respiratory Toxicity: | 0.273 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002205 | 0.689 | D0R2OA | 0.446 | ||||
ENC000982 | 0.552 | D06GCK | 0.372 | ||||
ENC002853 | 0.541 | D08CCE | 0.364 | ||||
ENC003482 | 0.463 | D09VXM | 0.351 | ||||
ENC001405 | 0.461 | D07JVL | 0.345 | ||||
ENC002759 | 0.444 | D0NS6H | 0.343 | ||||
ENC005618 | 0.442 | D0A1PX | 0.341 | ||||
ENC000962 | 0.439 | D09WKB | 0.341 | ||||
ENC006013 | 0.439 | D04BNP | 0.337 | ||||
ENC002858 | 0.438 | D0J6WW | 0.337 |