|
Name |
7,7,9,9,11,11-Hexamethyl-3,6,8,10,12,15-hexaoxa-7,9,11-trisilaheptadecane
|
Molecular Formula | C14H36O6Si3 | |
IUPAC Name* |
bis[[2-ethoxyethoxy(dimethyl)silyl]oxy]-dimethylsilane
|
|
SMILES |
CCOCCO[Si](C)(C)O[Si](C)(C)O[Si](C)(C)OCCOCC
|
|
InChI |
InChI=1S/C14H36O6Si3/c1-9-15-11-13-17-21(3,4)19-23(7,8)20-22(5,6)18-14-12-16-10-2/h9-14H2,1-8H3
|
|
InChIKey |
TUXFBCQKAFVQCP-UHFFFAOYSA-N
|
|
Synonyms |
7,7,9,9,11,11-Hexamethyl-3,6,8,10,12,15-hexaoxa-7,9,11-trisilaheptadecane
|
|
CAS | NA | |
PubChem CID | 91733917 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 384.69 | ALogp: | 3.2 |
HBD: | 0 | HBA: | 6 |
Rotatable Bonds: | 14 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 55.4 | Aromatic Rings: | 0 |
Heavy Atoms: | 23 | QED Weighted: | 0.333 |
Caco-2 Permeability: | -5.305 | MDCK Permeability: | 0.00003820 |
Pgp-inhibitor: | 0.722 | Pgp-substrate: | 0.003 |
Human Intestinal Absorption (HIA): | 0.001 | 20% Bioavailability (F20%): | 0.735 |
30% Bioavailability (F30%): | 0.065 |
Blood-Brain-Barrier Penetration (BBB): | 0 | Plasma Protein Binding (PPB): | 98.76% |
Volume Distribution (VD): | 1.187 | Fu: | 3.46% |
CYP1A2-inhibitor: | 0.286 | CYP1A2-substrate: | 0.926 |
CYP2C19-inhibitor: | 0.64 | CYP2C19-substrate: | 0.873 |
CYP2C9-inhibitor: | 0.307 | CYP2C9-substrate: | 0.68 |
CYP2D6-inhibitor: | 0.023 | CYP2D6-substrate: | 0.359 |
CYP3A4-inhibitor: | 0.087 | CYP3A4-substrate: | 0.119 |
Clearance (CL): | 3.529 | Half-life (T1/2): | 0.57 |
hERG Blockers: | 0.813 | Human Hepatotoxicity (H-HT): | 0.019 |
Drug-inuced Liver Injury (DILI): | 0.01 | AMES Toxicity: | 0.067 |
Rat Oral Acute Toxicity: | 0.001 | Maximum Recommended Daily Dose: | 0.026 |
Skin Sensitization: | 0.719 | Carcinogencity: | 0.034 |
Eye Corrosion: | 0.991 | Eye Irritation: | 0.985 |
Respiratory Toxicity: | 0.046 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003082 | 0.342 | D0U8AT | 0.174 | ||||
ENC001785 | 0.341 | D0Q7ZQ | 0.165 | ||||
ENC001784 | 0.320 | D0K3LW | 0.156 | ||||
ENC000373 | 0.307 | D05SJW | 0.156 | ||||
ENC001783 | 0.290 | D09CGE | 0.151 | ||||
ENC000530 | 0.258 | D09VBC | 0.150 | ||||
ENC000569 | 0.253 | D0K3ZR | 0.147 | ||||
ENC000605 | 0.250 | D0Q7ZG | 0.144 | ||||
ENC000269 | 0.243 | D0N6CR | 0.144 | ||||
ENC001404 | 0.236 | D0Q2ES | 0.143 |