|
Name |
2-(2-Butoxyethoxy)ethyl acetate
|
Molecular Formula | C10H20O4 | |
IUPAC Name* |
2-(2-butoxyethoxy)ethyl acetate
|
|
SMILES |
CCCCOCCOCCOC(=O)C
|
|
InChI |
InChI=1S/C10H20O4/c1-3-4-5-12-6-7-13-8-9-14-10(2)11/h3-9H2,1-2H3
|
|
InChIKey |
VXQBJTKSVGFQOL-UHFFFAOYSA-N
|
|
Synonyms |
2-(2-Butoxyethoxy)ethyl acetate; 124-17-4; Diethylene glycol monobutyl ether acetate; BUTYL CARBITOL ACETATE; Butoxyethoxyethyl acetate; Butyl diglycol acetate; Glycol ether DB aceatate; Diglycol monobutyl ether acetate; Ektasolve DB acetate; 2-(2-Butoxyethoxy)ethanol acetate; Ethanol, 2-(2-butoxyethoxy)-, acetate; Butyl diethylene glycol acetate; Butylkarbitolacetat; Diethylene glycol butyl ether acetate; Ethanol, 2-(2-butoxyethoxy)-, 1-acetate; Diethyleneglycol monobutyl ether acetate; NSC 5175; Acetic acid 2-(2-butoxyethoxy)ethyl ester; Diethylene glycol, monobutyl ether, acetate; 2-(2-Butoxyethoxy)ethylester kyseliny octove; diethyleneglycolmonobutyletheracetate; U6UTS77LXB; Diethylene glycol mono-n-butyl ether acetate; 2-(2-Butoxyethoxy) ethyl acetate; NSC-5175; NSC-6570; Diethylene glycol-monobutyl ether acetate; DSSTox_CID_7021; DSSTox_RID_78282; DSSTox_GSID_27021; WLN: 4O2O2OV1; Butylkarbitolacetat [Czech]; CAS-124-17-4; HSDB 334; EINECS 204-685-9; UNII-U6UTS77LXB; BRN 1771533; AI3-00170; DE Acetate; Butyldiglykolacetat; Sta-Way; Diethylene glycol butylether acetate; 2-(2-Butoxyethoxy)ethylester kyseliny octove [Czech]; 1-Butoxy-2-(2-acetoxyethoxy)-ethane; Glycol Ether DB Acetate; EC 204-685-9; HYKLEEN 340; SCHEMBL48354; CHEMBL1892052; DTXSID9027021; NSC5175; NSC6570; 2-(2-n-butoxyethoxy)ethyl acetate; ZINC1680748; Tox21_201957; Tox21_303055; MFCD00009458; AKOS015901615; NCGC00164259-01; NCGC00164259-02; NCGC00257140-01; NCGC00259506-01; Ethanol, 2-(2-butoxy-ethoxy)-, acetate; LS-13896; D0499; FT-0624896; 2-(2-Butoxyethoxy)ethyl acetate, >=99.2%; acetic acid 2-(2-butoxy-ethoxy)-ethyl ester; J-505564; Q11856099; DIETHYLENE GLYCOL MONOBUTYL ETHER ACETATE [HSDB]; Diethylene Glycol Monobutyl Ether Acetate (Reagent Grade); Diethylene glycol monobutyl ether acetate;Butyldiglycol acetate; Diethylene glycol monobutyl ether acetate, SAJ first grade, >=98.0%
|
|
CAS | 124-17-4 | |
PubChem CID | 31288 | |
ChEMBL ID | CHEMBL1892052 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 204.26 | ALogp: | 1.1 |
HBD: | 0 | HBA: | 4 |
Rotatable Bonds: | 10 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 44.8 | Aromatic Rings: | 0 |
Heavy Atoms: | 14 | QED Weighted: | 0.425 |
Caco-2 Permeability: | -4.261 | MDCK Permeability: | 0.00003820 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.001 | 20% Bioavailability (F20%): | 0.332 |
30% Bioavailability (F30%): | 0.068 |
Blood-Brain-Barrier Penetration (BBB): | 0.52 | Plasma Protein Binding (PPB): | 23.31% |
Volume Distribution (VD): | 0.605 | Fu: | 72.74% |
CYP1A2-inhibitor: | 0.076 | CYP1A2-substrate: | 0.188 |
CYP2C19-inhibitor: | 0.064 | CYP2C19-substrate: | 0.329 |
CYP2C9-inhibitor: | 0.028 | CYP2C9-substrate: | 0.041 |
CYP2D6-inhibitor: | 0.005 | CYP2D6-substrate: | 0.071 |
CYP3A4-inhibitor: | 0.015 | CYP3A4-substrate: | 0.22 |
Clearance (CL): | 8.022 | Half-life (T1/2): | 0.851 |
hERG Blockers: | 0.467 | Human Hepatotoxicity (H-HT): | 0.019 |
Drug-inuced Liver Injury (DILI): | 0.023 | AMES Toxicity: | 0.101 |
Rat Oral Acute Toxicity: | 0.017 | Maximum Recommended Daily Dose: | 0.007 |
Skin Sensitization: | 0.595 | Carcinogencity: | 0.314 |
Eye Corrosion: | 0.956 | Eye Irritation: | 0.988 |
Respiratory Toxicity: | 0.021 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000264 | 0.769 | D0AY9Q | 0.286 | ||||
ENC000269 | 0.591 | D0H2SY | 0.282 | ||||
ENC000602 | 0.500 | D0Q9HF | 0.280 | ||||
ENC000494 | 0.397 | D09VBC | 0.256 | ||||
ENC000855 | 0.396 | D0Q2ES | 0.256 | ||||
ENC000245 | 0.375 | D01QLH | 0.245 | ||||
ENC000211 | 0.365 | D09CGE | 0.237 | ||||
ENC000655 | 0.358 | D06ORU | 0.232 | ||||
ENC000854 | 0.333 | D0Q7ZG | 0.228 | ||||
ENC001671 | 0.333 | D0N6CR | 0.228 |