|
Name |
Diaporol I
|
Molecular Formula | C15H26O3 | |
IUPAC Name* |
(1R,2R,4aS,8aS)-2-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalene-1-carboxylic acid
|
|
SMILES |
C[C@]12CCCC([C@@H]1CC[C@@]([C@@H]2C(=O)O)(C)O)(C)C
|
|
InChI |
InChI=1S/C15H26O3/c1-13(2)7-5-8-14(3)10(13)6-9-15(4,18)11(14)12(16)17/h10-11,18H,5-9H2,1-4H3,(H,16,17)/t10-,11+,14-,15+/m0/s1
|
|
InChIKey |
VYGRCVWARMYZPO-IDTSFGKNSA-N
|
|
Synonyms |
Diaporol I; CHEMBL2152465
|
|
CAS | NA | |
PubChem CID | 71461981 | |
ChEMBL ID | CHEMBL2152465 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 254.36 | ALogp: | 3.9 |
HBD: | 2 | HBA: | 3 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 57.5 | Aromatic Rings: | 2 |
Heavy Atoms: | 18 | QED Weighted: | 0.747 |
Caco-2 Permeability: | -4.927 | MDCK Permeability: | 0.00002220 |
Pgp-inhibitor: | 0.008 | Pgp-substrate: | 0 |
Human Intestinal Absorption (HIA): | 0.011 | 20% Bioavailability (F20%): | 0.008 |
30% Bioavailability (F30%): | 0.055 |
Blood-Brain-Barrier Penetration (BBB): | 0.357 | Plasma Protein Binding (PPB): | 80.82% |
Volume Distribution (VD): | 0.414 | Fu: | 28.58% |
CYP1A2-inhibitor: | 0.013 | CYP1A2-substrate: | 0.423 |
CYP2C19-inhibitor: | 0.016 | CYP2C19-substrate: | 0.691 |
CYP2C9-inhibitor: | 0.085 | CYP2C9-substrate: | 0.87 |
CYP2D6-inhibitor: | 0.01 | CYP2D6-substrate: | 0.232 |
CYP3A4-inhibitor: | 0.033 | CYP3A4-substrate: | 0.058 |
Clearance (CL): | 4.525 | Half-life (T1/2): | 0.519 |
hERG Blockers: | 0.013 | Human Hepatotoxicity (H-HT): | 0.07 |
Drug-inuced Liver Injury (DILI): | 0.018 | AMES Toxicity: | 0.012 |
Rat Oral Acute Toxicity: | 0.278 | Maximum Recommended Daily Dose: | 0.015 |
Skin Sensitization: | 0.311 | Carcinogencity: | 0.067 |
Eye Corrosion: | 0.899 | Eye Irritation: | 0.918 |
Respiratory Toxicity: | 0.949 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003102 | 0.561 | D01CKY | 0.289 | ||||
ENC000946 | 0.544 | D0I2SD | 0.278 | ||||
ENC001452 | 0.524 | D04GJN | 0.278 | ||||
ENC004661 | 0.508 | D0Z1XD | 0.271 | ||||
ENC002608 | 0.500 | D0U3GL | 0.271 | ||||
ENC004662 | 0.492 | D0Q6NZ | 0.270 | ||||
ENC002266 | 0.486 | D0L2LS | 0.258 | ||||
ENC002918 | 0.484 | D07QKN | 0.254 | ||||
ENC002322 | 0.469 | D00HWO | 0.253 | ||||
ENC000956 | 0.452 | D0B4RU | 0.247 |