|
Name |
Scirpyrone A
|
Molecular Formula | C14H18O6 | |
IUPAC Name* |
6-[(2R,4R)-2-butyl-4-hydroxy-5-oxooxolan-2-yl]-4-methoxypyran-2-one
|
|
SMILES |
CCCC[C@@]1(C[C@H](C(=O)O1)O)C2=CC(=CC(=O)O2)OC
|
|
InChI |
InChI=1S/C14H18O6/c1-3-4-5-14(8-10(15)13(17)20-14)11-6-9(18-2)7-12(16)19-11/h6-7,10,15H,3-5,8H2,1-2H3/t10-,14-/m1/s1
|
|
InChIKey |
HKQVKOAOXNMGFT-QMTHXVAHSA-N
|
|
Synonyms |
Scirpyrone A
|
|
CAS | NA | |
PubChem CID | 57409271 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 282.29 | ALogp: | 1.3 |
HBD: | 1 | HBA: | 6 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 82.1 | Aromatic Rings: | 2 |
Heavy Atoms: | 20 | QED Weighted: | 0.829 |
Caco-2 Permeability: | -4.776 | MDCK Permeability: | 0.00002390 |
Pgp-inhibitor: | 0.013 | Pgp-substrate: | 0.709 |
Human Intestinal Absorption (HIA): | 0.047 | 20% Bioavailability (F20%): | 0.042 |
30% Bioavailability (F30%): | 0.887 |
Blood-Brain-Barrier Penetration (BBB): | 0.218 | Plasma Protein Binding (PPB): | 86.90% |
Volume Distribution (VD): | 0.931 | Fu: | 21.23% |
CYP1A2-inhibitor: | 0.038 | CYP1A2-substrate: | 0.877 |
CYP2C19-inhibitor: | 0.13 | CYP2C19-substrate: | 0.838 |
CYP2C9-inhibitor: | 0.06 | CYP2C9-substrate: | 0.256 |
CYP2D6-inhibitor: | 0.009 | CYP2D6-substrate: | 0.762 |
CYP3A4-inhibitor: | 0.045 | CYP3A4-substrate: | 0.179 |
Clearance (CL): | 6.936 | Half-life (T1/2): | 0.838 |
hERG Blockers: | 0.016 | Human Hepatotoxicity (H-HT): | 0.237 |
Drug-inuced Liver Injury (DILI): | 0.386 | AMES Toxicity: | 0.06 |
Rat Oral Acute Toxicity: | 0.476 | Maximum Recommended Daily Dose: | 0.354 |
Skin Sensitization: | 0.179 | Carcinogencity: | 0.119 |
Eye Corrosion: | 0.013 | Eye Irritation: | 0.642 |
Respiratory Toxicity: | 0.065 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005564 | 0.455 | D0O3AB | 0.250 | ||||
ENC006020 | 0.403 | D0L7AS | 0.240 | ||||
ENC005210 | 0.382 | D0P1FO | 0.240 | ||||
ENC003881 | 0.382 | D0T1LK | 0.225 | ||||
ENC005859 | 0.380 | D0S5CH | 0.220 | ||||
ENC006019 | 0.377 | D00XWD | 0.216 | ||||
ENC006021 | 0.373 | D0C1SF | 0.212 | ||||
ENC006023 | 0.371 | D05CKR | 0.212 | ||||
ENC002479 | 0.368 | D06FVX | 0.208 | ||||
ENC005860 | 0.361 | D03ELL | 0.206 |