|
Name |
dichlorodiaportinolide
|
Molecular Formula | C16H14Cl2O7 | |
IUPAC Name* |
3-[[2-(dichloromethyl)-4-hydroxy-5-oxooxolan-2-yl]methyl]-8-hydroxy-6-methoxyisochromen-1-one
|
|
SMILES |
COc1cc(O)c2c(=O)oc(CC3(C(Cl)Cl)CC(O)C(=O)O3)cc2c1
|
|
InChI |
InChI=1S/C16H14Cl2O7/c1-23-8-2-7-3-9(24-14(22)12(7)10(19)4-8)5-16(15(17)18)6-11(20)13(21)25-16/h2-4,11,15,19-20H,5-6H2,1H3/t11-,16-/m0/s1
|
|
InChIKey |
WVPCKHBOHMSILA-ZBEGNZNMSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 389.19 | ALogp: | 1.9 |
HBD: | 2 | HBA: | 7 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 106.2 | Aromatic Rings: | 3 |
Heavy Atoms: | 25 | QED Weighted: | 0.611 |
Caco-2 Permeability: | -5.028 | MDCK Permeability: | 0.00003820 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.958 |
Human Intestinal Absorption (HIA): | 0.059 | 20% Bioavailability (F20%): | 0.004 |
30% Bioavailability (F30%): | 0.025 |
Blood-Brain-Barrier Penetration (BBB): | 0.108 | Plasma Protein Binding (PPB): | 95.15% |
Volume Distribution (VD): | 0.839 | Fu: | 3.69% |
CYP1A2-inhibitor: | 0.204 | CYP1A2-substrate: | 0.974 |
CYP2C19-inhibitor: | 0.041 | CYP2C19-substrate: | 0.875 |
CYP2C9-inhibitor: | 0.069 | CYP2C9-substrate: | 0.519 |
CYP2D6-inhibitor: | 0.01 | CYP2D6-substrate: | 0.722 |
CYP3A4-inhibitor: | 0.06 | CYP3A4-substrate: | 0.196 |
Clearance (CL): | 7.871 | Half-life (T1/2): | 0.855 |
hERG Blockers: | 0.01 | Human Hepatotoxicity (H-HT): | 0.554 |
Drug-inuced Liver Injury (DILI): | 0.406 | AMES Toxicity: | 0.203 |
Rat Oral Acute Toxicity: | 0.681 | Maximum Recommended Daily Dose: | 0.249 |
Skin Sensitization: | 0.193 | Carcinogencity: | 0.604 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.104 |
Respiratory Toxicity: | 0.682 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003881 | 1.000 | D07MGA | 0.252 | ||||
ENC003882 | 0.797 | D06GCK | 0.234 | ||||
ENC001634 | 0.584 | D04UTT | 0.227 | ||||
ENC001632 | 0.539 | D04AIT | 0.223 | ||||
ENC005211 | 0.539 | D0C1SF | 0.220 | ||||
ENC002072 | 0.519 | D0K8KX | 0.219 | ||||
ENC005212 | 0.494 | D08SKH | 0.213 | ||||
ENC004994 | 0.494 | D0DJ1B | 0.211 | ||||
ENC002113 | 0.473 | D0FA2O | 0.211 | ||||
ENC003464 | 0.440 | D0G4KG | 0.210 |