|
Name |
(3E,5R)-3-[[(1R,2S,4aR,6S,8aS)-1,3,6-trimethyl-2-[(1E,3E)-penta-1,3-dienyl]-4a,5,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]-hydroxymethylidene]-5-(hydroxymethyl)-1-methylpyrrolidine-2,4-dione
|
Molecular Formula | C25H35NO4 | |
IUPAC Name* |
(3E,5R)-3-[[(1R,2S,4aR,6S,8aS)-1,3,6-trimethyl-2-[(1E,3E)-penta-1,3-dienyl]-4a,5,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]-hydroxymethylidene]-5-(hydroxymethyl)-1-methylpyrrolidine-2,4-dione
|
|
SMILES |
C/C=C/C=C/[C@H]1C(=C[C@H]2C[C@H](CC[C@@H]2[C@@]1(C)/C(=C\3/C(=O)[C@H](N(C3=O)C)CO)/O)C)C
|
|
InChI |
InChI=1S/C25H35NO4/c1-6-7-8-9-18-16(3)13-17-12-15(2)10-11-19(17)25(18,4)23(29)21-22(28)20(14-27)26(5)24(21)30/h6-9,13,15,17-20,27,29H,10-12,14H2,1-5H3/b7-6+,9-8+,23-21+/t15-,17+,18-,19-,20+,25-/m0/s1
|
|
InChIKey |
GQYNYOOJEMDNNZ-KXBMYEHISA-N
|
|
Synonyms |
Phomasetin; SCHEMBL20199919
|
|
CAS | NA | |
PubChem CID | 54711946 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 413.5 | ALogp: | 4.7 |
HBD: | 2 | HBA: | 4 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 77.8 | Aromatic Rings: | 3 |
Heavy Atoms: | 30 | QED Weighted: | 0.232 |
Caco-2 Permeability: | -4.655 | MDCK Permeability: | 0.00001280 |
Pgp-inhibitor: | 0.057 | Pgp-substrate: | 0.639 |
Human Intestinal Absorption (HIA): | 0.01 | 20% Bioavailability (F20%): | 0.011 |
30% Bioavailability (F30%): | 0.003 |
Blood-Brain-Barrier Penetration (BBB): | 0.075 | Plasma Protein Binding (PPB): | 96.82% |
Volume Distribution (VD): | 1.026 | Fu: | 4.64% |
CYP1A2-inhibitor: | 0.723 | CYP1A2-substrate: | 0.814 |
CYP2C19-inhibitor: | 0.505 | CYP2C19-substrate: | 0.666 |
CYP2C9-inhibitor: | 0.772 | CYP2C9-substrate: | 0.965 |
CYP2D6-inhibitor: | 0.826 | CYP2D6-substrate: | 0.888 |
CYP3A4-inhibitor: | 0.729 | CYP3A4-substrate: | 0.355 |
Clearance (CL): | 3.328 | Half-life (T1/2): | 0.457 |
hERG Blockers: | 0.018 | Human Hepatotoxicity (H-HT): | 0.372 |
Drug-inuced Liver Injury (DILI): | 0.305 | AMES Toxicity: | 0.326 |
Rat Oral Acute Toxicity: | 0.623 | Maximum Recommended Daily Dose: | 0.783 |
Skin Sensitization: | 0.814 | Carcinogencity: | 0.865 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.031 |
Respiratory Toxicity: | 0.885 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005181 | 0.710 | D0E9KA | 0.254 | ||||
ENC005182 | 0.710 | D0I5DS | 0.232 | ||||
ENC004028 | 0.674 | D04SFH | 0.231 | ||||
ENC003021 | 0.608 | D0W2EK | 0.224 | ||||
ENC003630 | 0.524 | D0D2TN | 0.222 | ||||
ENC003745 | 0.491 | D08PIQ | 0.222 | ||||
ENC004321 | 0.477 | D0CZ1Q | 0.222 | ||||
ENC004320 | 0.477 | D06AEO | 0.216 | ||||
ENC004322 | 0.477 | D0I1LH | 0.214 | ||||
ENC005775 | 0.477 | D0C8HR | 0.212 |