|
Name |
Neopestalotin D
|
Molecular Formula | C25H35NO6 | |
IUPAC Name* |
[(2S,4aR,5S,6R,8aS)-5-[(Z)-hydroxy-[(5S)-5-[(1R)-1-hydroxyethyl]-2,4-dioxopyrrolidin-3-ylidene]methyl]-5,7-dimethyl-6-[(E)-prop-1-enyl]-2,3,4,4a,6,8a-hexahydro-1H-naphthalen-2-yl]methyl acetate
|
|
SMILES |
C/C=C/[C@@H]1C(=C[C@@H]2C[C@H](CC[C@H]2[C@]1(C)/C(=C/3\C(=O)[C@@H](NC3=O)[C@@H](C)O)/O)COC(=O)C)C
|
|
InChI |
InChI=1S/C25H35NO6/c1-6-7-18-13(2)10-17-11-16(12-32-15(4)28)8-9-19(17)25(18,5)23(30)20-22(29)21(14(3)27)26-24(20)31/h6-7,10,14,16-19,21,27,30H,8-9,11-12H2,1-5H3,(H,26,31)/b7-6+,23-20-/t14-,16+,17-,18-,19-,21+,25-/m1/s1
|
|
InChIKey |
KBJBNBKVTYSUKZ-LHNSTSOTSA-N
|
|
Synonyms |
Neopestalotin D
|
|
CAS | NA | |
PubChem CID | 139587459 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 445.5 | ALogp: | 3.3 |
HBD: | 3 | HBA: | 6 |
Rotatable Bonds: | 6 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 113.0 | Aromatic Rings: | 3 |
Heavy Atoms: | 32 | QED Weighted: | 0.195 |
Caco-2 Permeability: | -5.174 | MDCK Permeability: | 0.00000604 |
Pgp-inhibitor: | 0.009 | Pgp-substrate: | 0.988 |
Human Intestinal Absorption (HIA): | 0.889 | 20% Bioavailability (F20%): | 0.313 |
30% Bioavailability (F30%): | 0.02 |
Blood-Brain-Barrier Penetration (BBB): | 0.062 | Plasma Protein Binding (PPB): | 93.19% |
Volume Distribution (VD): | 1.357 | Fu: | 6.28% |
CYP1A2-inhibitor: | 0.313 | CYP1A2-substrate: | 0.186 |
CYP2C19-inhibitor: | 0.162 | CYP2C19-substrate: | 0.089 |
CYP2C9-inhibitor: | 0.572 | CYP2C9-substrate: | 0.786 |
CYP2D6-inhibitor: | 0.742 | CYP2D6-substrate: | 0.145 |
CYP3A4-inhibitor: | 0.696 | CYP3A4-substrate: | 0.268 |
Clearance (CL): | 1.907 | Half-life (T1/2): | 0.701 |
hERG Blockers: | 0.01 | Human Hepatotoxicity (H-HT): | 0.706 |
Drug-inuced Liver Injury (DILI): | 0.719 | AMES Toxicity: | 0.009 |
Rat Oral Acute Toxicity: | 0.406 | Maximum Recommended Daily Dose: | 0.672 |
Skin Sensitization: | 0.113 | Carcinogencity: | 0.02 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.014 |
Respiratory Toxicity: | 0.937 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003021 | 0.769 | D0E9KA | 0.263 | ||||
ENC003689 | 0.663 | D09WYX | 0.261 | ||||
ENC003602 | 0.619 | D0V2JK | 0.250 | ||||
ENC003630 | 0.528 | D0X4RS | 0.250 | ||||
ENC002818 | 0.491 | D02CJX | 0.248 | ||||
ENC005182 | 0.451 | D0O5FY | 0.240 | ||||
ENC005181 | 0.451 | D02CNR | 0.235 | ||||
ENC003713 | 0.400 | D0G7KJ | 0.234 | ||||
ENC004028 | 0.395 | D08BDT | 0.234 | ||||
ENC003491 | 0.389 | D0W2EK | 0.233 |