|
Name |
1,2-Benzenedicarboxylic acid butyl-2-ethylhexyl ester
|
Molecular Formula | C20H30O4 | |
IUPAC Name* |
2-(6-ethyldecan-5-yloxycarbonyl)benzoic acid
|
|
SMILES |
CCCCC(CC)C(CCCC)OC(=O)C1=CC=CC=C1C(=O)O
|
|
InChI |
InChI=1S/C20H30O4/c1-4-7-11-15(6-3)18(14-8-5-2)24-20(23)17-13-10-9-12-16(17)19(21)22/h9-10,12-13,15,18H,4-8,11,14H2,1-3H3,(H,21,22)
|
|
InChIKey |
YFVLFMOCNVJYHW-UHFFFAOYSA-N
|
|
Synonyms |
SCHEMBL231234; 1,2-benzenedicarboxylic acid butyl-2-ethylhexyl ester
|
|
CAS | NA | |
PubChem CID | 54506123 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 334.4 | ALogp: | 6.3 |
HBD: | 1 | HBA: | 4 |
Rotatable Bonds: | 12 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 63.6 | Aromatic Rings: | 1 |
Heavy Atoms: | 24 | QED Weighted: | 0.537 |
Caco-2 Permeability: | -4.654 | MDCK Permeability: | 0.00002540 |
Pgp-inhibitor: | 0.517 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.003 | 20% Bioavailability (F20%): | 0.016 |
30% Bioavailability (F30%): | 0.486 |
Blood-Brain-Barrier Penetration (BBB): | 0.06 | Plasma Protein Binding (PPB): | 99.26% |
Volume Distribution (VD): | 0.38 | Fu: | 0.97% |
CYP1A2-inhibitor: | 0.202 | CYP1A2-substrate: | 0.812 |
CYP2C19-inhibitor: | 0.081 | CYP2C19-substrate: | 0.131 |
CYP2C9-inhibitor: | 0.411 | CYP2C9-substrate: | 0.695 |
CYP2D6-inhibitor: | 0.209 | CYP2D6-substrate: | 0.08 |
CYP3A4-inhibitor: | 0.172 | CYP3A4-substrate: | 0.118 |
Clearance (CL): | 2.434 | Half-life (T1/2): | 0.395 |
hERG Blockers: | 0.301 | Human Hepatotoxicity (H-HT): | 0.125 |
Drug-inuced Liver Injury (DILI): | 0.855 | AMES Toxicity: | 0.002 |
Rat Oral Acute Toxicity: | 0.021 | Maximum Recommended Daily Dose: | 0.011 |
Skin Sensitization: | 0.081 | Carcinogencity: | 0.06 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.924 |
Respiratory Toxicity: | 0.476 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000544 | 0.613 | D0GY5Z | 0.347 | ||||
ENC000157 | 0.565 | D0X4FM | 0.318 | ||||
ENC001802 | 0.553 | D0P5GE | 0.317 | ||||
ENC000290 | 0.548 | D0Y0JH | 0.308 | ||||
ENC000301 | 0.528 | D0K8CI | 0.307 | ||||
ENC000090 | 0.506 | D06ORU | 0.306 | ||||
ENC000158 | 0.462 | D03LGY | 0.293 | ||||
ENC000669 | 0.457 | D07HBX | 0.292 | ||||
ENC001804 | 0.456 | D0A5CM | 0.290 | ||||
ENC001027 | 0.446 | D0N3UL | 0.288 |