|
Name |
Butyl 2-ethylhexyl phthalate
|
Molecular Formula | C20H30O4 | |
IUPAC Name* |
1-O-butyl 2-O-(2-ethylhexyl) benzene-1,2-dicarboxylate
|
|
SMILES |
CCCCC(CC)COC(=O)C1=CC=CC=C1C(=O)OCCCC
|
|
InChI |
InChI=1S/C20H30O4/c1-4-7-11-16(6-3)15-24-20(22)18-13-10-9-12-17(18)19(21)23-14-8-5-2/h9-10,12-13,16H,4-8,11,14-15H2,1-3H3
|
|
InChIKey |
AVOLBYOSCILFLL-UHFFFAOYSA-N
|
|
Synonyms |
Butyl 2-ethylhexyl phthalate; 85-69-8; 1,2-Benzenedicarboxylic acid, butyl 2-ethylhexyl ester; 1-O-butyl 2-O-(2-ethylhexyl) benzene-1,2-dicarboxylate; Phthalic acid, butyl 2-ethylhexyl ester; 40AV6S4MYV; Butyl 2-ethylhexyl phthalate(Technical); 1,2-Benzenedicarboxylicacid, 1-butyl 2-(2-ethylhexyl) ester; 1,2-Benzenedicarboxylic acid, 1-butyl 2-(2-ethylhexyl) ester; 2-ETHYLHEXYL BUTYL PHTHALATE; UNII-40AV6S4MYV; HSDB 5251; EINECS 201-623-2; DSSTox_CID_6519; DSSTox_RID_78133; DSSTox_GSID_26519; SCHEMBL231235; CHEMBL3188746; DTXSID8026519; CHEBI:191077; Tox21_200061; CAS-85-69-8; 1-Butyl 2-(2-ethylhexyl) phthalate #; NCGC00248509-01; NCGC00257615-01; Phthalic acid, butyl(2-ethylhexyl) ester; 2-ETHYLHEXYL BUTYL PHTHALATE [HSDB]; Phthalic acid 1-butyl 2-(2-ethylhexyl) ester; Q27258316
|
|
CAS | 85-69-8 | |
PubChem CID | 6818 | |
ChEMBL ID | CHEMBL3188746 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 334.4 | ALogp: | 5.6 |
HBD: | 0 | HBA: | 4 |
Rotatable Bonds: | 13 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 52.6 | Aromatic Rings: | 1 |
Heavy Atoms: | 24 | QED Weighted: | 0.404 |
Caco-2 Permeability: | -4.601 | MDCK Permeability: | 0.00002140 |
Pgp-inhibitor: | 0.96 | Pgp-substrate: | 0.002 |
Human Intestinal Absorption (HIA): | 0.002 | 20% Bioavailability (F20%): | 0.991 |
30% Bioavailability (F30%): | 0.989 |
Blood-Brain-Barrier Penetration (BBB): | 0.024 | Plasma Protein Binding (PPB): | 98.48% |
Volume Distribution (VD): | 1.1 | Fu: | 1.43% |
CYP1A2-inhibitor: | 0.683 | CYP1A2-substrate: | 0.371 |
CYP2C19-inhibitor: | 0.856 | CYP2C19-substrate: | 0.064 |
CYP2C9-inhibitor: | 0.531 | CYP2C9-substrate: | 0.284 |
CYP2D6-inhibitor: | 0.812 | CYP2D6-substrate: | 0.116 |
CYP3A4-inhibitor: | 0.766 | CYP3A4-substrate: | 0.111 |
Clearance (CL): | 10.197 | Half-life (T1/2): | 0.197 |
hERG Blockers: | 0.213 | Human Hepatotoxicity (H-HT): | 0.01 |
Drug-inuced Liver Injury (DILI): | 0.139 | AMES Toxicity: | 0.004 |
Rat Oral Acute Toxicity: | 0.003 | Maximum Recommended Daily Dose: | 0.019 |
Skin Sensitization: | 0.901 | Carcinogencity: | 0.467 |
Eye Corrosion: | 0.039 | Eye Irritation: | 0.98 |
Respiratory Toxicity: | 0.056 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000290 | 0.768 | D0X4FM | 0.392 | ||||
ENC000090 | 0.732 | D06ORU | 0.372 | ||||
ENC000586 | 0.694 | D0K8CI | 0.358 | ||||
ENC000544 | 0.694 | D0H2SY | 0.347 | ||||
ENC001801 | 0.675 | D0P5GE | 0.340 | ||||
ENC000669 | 0.667 | D0N6CR | 0.330 | ||||
ENC000158 | 0.654 | D0E9WO | 0.313 | ||||
ENC000164 | 0.621 | D08HQK | 0.304 | ||||
ENC000300 | 0.603 | D0Q7ZG | 0.302 | ||||
ENC001802 | 0.602 | D0VL8Q | 0.294 |