|
Name |
4-(Hydroxymethyl)-5-hydroxy-2h-pyran-2-one
|
Molecular Formula | C6H6O4 | |
IUPAC Name* |
5-hydroxy-4-(hydroxymethyl)pyran-2-one
|
|
SMILES |
C1=C(C(=COC1=O)O)CO
|
|
InChI |
InChI=1S/C6H6O4/c7-2-4-1-6(9)10-3-5(4)8/h1,3,7-8H,2H2
|
|
InChIKey |
YHVOEGJCPPEQKG-UHFFFAOYSA-N
|
|
Synonyms |
4-(hydroxymethyl)-5-hydroxy-2h-pyran-2-one; CHEMBL4525476
|
|
CAS | NA | |
PubChem CID | 24864462 | |
ChEMBL ID | CHEMBL4525476 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 142.11 | ALogp: | -0.6 |
HBD: | 2 | HBA: | 4 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 66.8 | Aromatic Rings: | 1 |
Heavy Atoms: | 10 | QED Weighted: | 0.589 |
Caco-2 Permeability: | -4.695 | MDCK Permeability: | 0.00017181 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.872 |
Human Intestinal Absorption (HIA): | 0.011 | 20% Bioavailability (F20%): | 0.502 |
30% Bioavailability (F30%): | 0.992 |
Blood-Brain-Barrier Penetration (BBB): | 0.09 | Plasma Protein Binding (PPB): | 49.13% |
Volume Distribution (VD): | 0.678 | Fu: | 68.33% |
CYP1A2-inhibitor: | 0.241 | CYP1A2-substrate: | 0.238 |
CYP2C19-inhibitor: | 0.032 | CYP2C19-substrate: | 0.056 |
CYP2C9-inhibitor: | 0.006 | CYP2C9-substrate: | 0.342 |
CYP2D6-inhibitor: | 0.018 | CYP2D6-substrate: | 0.444 |
CYP3A4-inhibitor: | 0.006 | CYP3A4-substrate: | 0.125 |
Clearance (CL): | 10.999 | Half-life (T1/2): | 0.923 |
hERG Blockers: | 0.074 | Human Hepatotoxicity (H-HT): | 0.104 |
Drug-inuced Liver Injury (DILI): | 0.336 | AMES Toxicity: | 0.02 |
Rat Oral Acute Toxicity: | 0.189 | Maximum Recommended Daily Dose: | 0.018 |
Skin Sensitization: | 0.599 | Carcinogencity: | 0.802 |
Eye Corrosion: | 0.232 | Eye Irritation: | 0.977 |
Respiratory Toxicity: | 0.206 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004766 | 0.550 | D02ZJI | 0.286 | ||||
ENC000101 | 0.543 | D0K5CB | 0.286 | ||||
ENC000985 | 0.421 | D07MUN | 0.250 | ||||
ENC002875 | 0.366 | D01WJL | 0.244 | ||||
ENC006095 | 0.357 | D0C4YC | 0.244 | ||||
ENC002334 | 0.350 | D0T7OW | 0.239 | ||||
ENC006096 | 0.348 | D07AHW | 0.234 | ||||
ENC003984 | 0.346 | D08HVR | 0.231 | ||||
ENC003983 | 0.346 | D07MOX | 0.229 | ||||
ENC003365 | 0.333 | D0BA6T | 0.222 |