|
Name |
Ginsenoside Rh1
|
Molecular Formula | C36H62O9 | |
IUPAC Name* |
(2R,3R,4S,5S,6R)-2-[[(3S,5R,6S,8R,9R,10R,12R,13R,14R,17S)-3,12-dihydroxy-17-[(2S)-2-hydroxy-6-methylhept-5-en-2-yl]-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-6-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol
|
|
SMILES |
CC(=CCC[C@@](C)([C@H]1CC[C@@]2([C@@H]1[C@@H](C[C@H]3[C@]2(C[C@@H]([C@@H]4[C@@]3(CC[C@@H](C4(C)C)O)C)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)C)O)C)O)C
|
|
InChI |
InChI=1S/C36H62O9/c1-19(2)10-9-13-36(8,43)20-11-15-34(6)26(20)21(38)16-24-33(5)14-12-25(39)32(3,4)30(33)22(17-35(24,34)7)44-31-29(42)28(41)27(40)23(18-37)45-31/h10,20-31,37-43H,9,11-18H2,1-8H3/t20-,21+,22-,23+,24+,25-,26-,27+,28-,29+,30-,31+,33+,34+,35+,36-/m0/s1
|
|
InChIKey |
RAQNTCRNSXYLAH-RFCGZQMISA-N
|
|
Synonyms |
Ginsenoside Rh1; 63223-86-9; 20(S)-Ginsenoside Rh1; Sanchinoside B2; Prosapogenin A2; Sanchinoside Rh1; XBR6F7G8FU; ginsenoside-Rh1; MFCD09951797; ginsenoside Rh(1); ginsenoside G-Rh(1); GINSENOSIDE RH 1; UNII-XBR6F7G8FU; S-GINSENOSIDE RH1; (20S)-ginsenoside Rh1; BIDD:ER0183; CHEMBL466844; DTXSID80979245; (3beta,6alpha,12beta)-3,12,20-Trihydroxydammar-24-en-6-yl beta-D-glucopyranoside; CHEBI:142487; HMS3886D18; (2R,3R,4S,5S,6R)-2-[[(3S,5R,6S,8R,9R,10R,12R,13R,14R,17S)-3,12-dihydroxy-17-[(2S)-2-hydroxy-6-methylhept-5-en-2-yl]-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-6-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol; HY-N0604; GINSENOSIDE RH1, (20S)-; BDBM50023447; Ginsenoside Rh1, analytical standard; s9129; ZINC49852137; AKOS025311542; CCG-270315; CS-3834; AS-75346; C22129; A834283; Q-100729; beta-D-Glucopyranoside, (3beta,6alpha,12beta)-3,12,20-trihydroxydammar-24-en-6-yl; (2R,3R,4S,5S,6R)-2-[[(3S,5R,6S,8R,10R,12R,14R,17S)-3,12-dihydroxy-17-[(2R)-2-hydroxy-6-methylhept-5-en-2-yl]-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-6-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol; (2R,3R,4S,5S,6R)-2-{[(1S,3aR,3bR,5S,5aR,7S,9aR,9bR,11R,11aR)-7,11-dihydroxy-1-[(2S)-2-hydroxy-6-methylhept-5-en-2-yl]-3a,3b,6,6,9a-pentamethyl-hexadecahydro-1H-cyclopenta[a]phenanthren-5-yl]oxy}-6-(hydroxymethyl)oxane-3,4,5-triol; (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[[(3S,5R,6S,8R,9R,10R,12R,13R,14R,17S)-4,4,8,10,14-pentamethyl-17-[(2S)-6-methyl-2-oxidanyl-hept-5-en-2-yl]-3,12-bis(oxidanyl)-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-6-yl]oxy]oxane-3,4,5-; .BETA.-D-GLUCOPYRANOSIDE, (3.BETA.,6.ALPHA.,12.BETA.)-3,12,20-TRIHYDROXYDAMMAR-24-EN-6-YL
|
|
CAS | 63223-86-9 | |
PubChem CID | 12855920 | |
ChEMBL ID | CHEMBL466844 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 638.9 | ALogp: | 4.3 |
HBD: | 7 | HBA: | 9 |
Rotatable Bonds: | 7 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 160.0 | Aromatic Rings: | 5 |
Heavy Atoms: | 45 | QED Weighted: | 0.161 |
Caco-2 Permeability: | -5.161 | MDCK Permeability: | 0.00003070 |
Pgp-inhibitor: | 0.996 | Pgp-substrate: | 0.057 |
Human Intestinal Absorption (HIA): | 0.184 | 20% Bioavailability (F20%): | 0.893 |
30% Bioavailability (F30%): | 0.973 |
Blood-Brain-Barrier Penetration (BBB): | 0.015 | Plasma Protein Binding (PPB): | 83.47% |
Volume Distribution (VD): | 0.615 | Fu: | 6.79% |
CYP1A2-inhibitor: | 0.004 | CYP1A2-substrate: | 0.12 |
CYP2C19-inhibitor: | 0.004 | CYP2C19-substrate: | 0.709 |
CYP2C9-inhibitor: | 0.022 | CYP2C9-substrate: | 0.062 |
CYP2D6-inhibitor: | 0.002 | CYP2D6-substrate: | 0.074 |
CYP3A4-inhibitor: | 0.162 | CYP3A4-substrate: | 0.132 |
Clearance (CL): | 1.637 | Half-life (T1/2): | 0.491 |
hERG Blockers: | 0.13 | Human Hepatotoxicity (H-HT): | 0.259 |
Drug-inuced Liver Injury (DILI): | 0.009 | AMES Toxicity: | 0.029 |
Rat Oral Acute Toxicity: | 0.284 | Maximum Recommended Daily Dose: | 0.048 |
Skin Sensitization: | 0.686 | Carcinogencity: | 0.009 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.018 |
Respiratory Toxicity: | 0.96 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001918 | 0.818 | D04RYU | 0.365 | ||||
ENC000865 | 0.776 | D0X7XG | 0.344 | ||||
ENC002152 | 0.694 | D03MTN | 0.343 | ||||
ENC001939 | 0.665 | D0AR3J | 0.341 | ||||
ENC001938 | 0.614 | D0P2IT | 0.338 | ||||
ENC002655 | 0.520 | D07QQD | 0.333 | ||||
ENC002180 | 0.520 | D04MRG | 0.319 | ||||
ENC001894 | 0.462 | D0P6IK | 0.312 | ||||
ENC002245 | 0.462 | D09HTS | 0.309 | ||||
ENC001933 | 0.451 | D0S0NK | 0.305 |