|
Name |
Methyl 2-(4-(hydroxymethyl)phenyl)acetate
|
Molecular Formula | C10H12O3 | |
IUPAC Name* |
methyl 2-[4-(hydroxymethyl)phenyl]acetate
|
|
SMILES |
COC(=O)CC1=CC=C(C=C1)CO
|
|
InChI |
InChI=1S/C10H12O3/c1-13-10(12)6-8-2-4-9(7-11)5-3-8/h2-5,11H,6-7H2,1H3
|
|
InChIKey |
LLDQUDYCTIKKFV-UHFFFAOYSA-N
|
|
Synonyms |
methyl 2-(4-(hydroxymethyl)phenyl)acetate; 155380-11-3; METHYL 2-[4-(HYDROXYMETHYL)PHENYL]ACETATE; Benzeneacetic acid, 4-(hydroxymethyl)-, methyl ester; SCHEMBL112297; DTXSID80503105; methyl p-hydroxymethylphenylacetate; MFCD08061910; ZINC39249059; AKOS006287393; methyl [4-(hydroxymethyl)phenyl]acetate; methyl2-(4-(hydroxymethyl)phenyl)acetate; CS-0187457; FT-0774848; E77966; (4-hydroxymethyl-phenyl)-acetic acid methyl ester; A907332
|
|
CAS | 155380-11-3 | |
PubChem CID | 12575321 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 180.2 | ALogp: | 0.9 |
HBD: | 1 | HBA: | 3 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 46.5 | Aromatic Rings: | 1 |
Heavy Atoms: | 13 | QED Weighted: | 0.713 |
Caco-2 Permeability: | -4.345 | MDCK Permeability: | 0.00005260 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.056 |
Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.002 |
30% Bioavailability (F30%): | 0.282 |
Blood-Brain-Barrier Penetration (BBB): | 0.689 | Plasma Protein Binding (PPB): | 34.73% |
Volume Distribution (VD): | 0.672 | Fu: | 64.73% |
CYP1A2-inhibitor: | 0.458 | CYP1A2-substrate: | 0.358 |
CYP2C19-inhibitor: | 0.531 | CYP2C19-substrate: | 0.646 |
CYP2C9-inhibitor: | 0.113 | CYP2C9-substrate: | 0.281 |
CYP2D6-inhibitor: | 0.019 | CYP2D6-substrate: | 0.532 |
CYP3A4-inhibitor: | 0.041 | CYP3A4-substrate: | 0.507 |
Clearance (CL): | 9.21 | Half-life (T1/2): | 0.894 |
hERG Blockers: | 0.039 | Human Hepatotoxicity (H-HT): | 0.155 |
Drug-inuced Liver Injury (DILI): | 0.836 | AMES Toxicity: | 0.059 |
Rat Oral Acute Toxicity: | 0.047 | Maximum Recommended Daily Dose: | 0.011 |
Skin Sensitization: | 0.279 | Carcinogencity: | 0.225 |
Eye Corrosion: | 0.005 | Eye Irritation: | 0.708 |
Respiratory Toxicity: | 0.028 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004860 | 0.683 | D02HXS | 0.397 | ||||
ENC000223 | 0.524 | D02AQY | 0.396 | ||||
ENC000208 | 0.489 | D03XTC | 0.362 | ||||
ENC002095 | 0.479 | D01UXC | 0.354 | ||||
ENC001338 | 0.440 | D0B3QM | 0.352 | ||||
ENC000774 | 0.435 | D01CRB | 0.340 | ||||
ENC000006 | 0.435 | D0R1QE | 0.333 | ||||
ENC000222 | 0.422 | D0Y7EM | 0.323 | ||||
ENC001422 | 0.412 | D0W1RY | 0.314 | ||||
ENC002602 | 0.409 | D05CKR | 0.313 |