|
Name |
Anthraquinone, 1,4-dihydroxy-6-methyl-
|
Molecular Formula | C15H10O4 | |
IUPAC Name* |
1,4-dihydroxy-6-methylanthracene-9,10-dione
|
|
SMILES |
CC1=CC2=C(C=C1)C(=O)C3=C(C=CC(=C3C2=O)O)O
|
|
InChI |
InChI=1S/C15H10O4/c1-7-2-3-8-9(6-7)15(19)13-11(17)5-4-10(16)12(13)14(8)18/h2-6,16-17H,1H3
|
|
InChIKey |
JKVKLDWULQJCIS-UHFFFAOYSA-N
|
|
Synonyms |
14569-42-7; 1,4-Dihydroxy-6-methylanthracene-9,10-dione; 6-Methylquinizarin; 6-methyl-quinizarin; Anthraquinone, 1,4-dihydroxy-6-methyl-; SCHEMBL375798; DTXSID80932673; 6-methyl-1,4-dihydroxyanthraquinone; ZINC13334388
|
|
CAS | 14569-42-7 | |
PubChem CID | 11230545 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 254.24 | ALogp: | 3.6 |
HBD: | 2 | HBA: | 4 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 74.6 | Aromatic Rings: | 3 |
Heavy Atoms: | 19 | QED Weighted: | 0.605 |
Caco-2 Permeability: | -4.916 | MDCK Permeability: | 0.00001360 |
Pgp-inhibitor: | 0.005 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.036 | 20% Bioavailability (F20%): | 0.004 |
30% Bioavailability (F30%): | 0.929 |
Blood-Brain-Barrier Penetration (BBB): | 0.026 | Plasma Protein Binding (PPB): | 99.77% |
Volume Distribution (VD): | 0.362 | Fu: | 1.06% |
CYP1A2-inhibitor: | 0.972 | CYP1A2-substrate: | 0.232 |
CYP2C19-inhibitor: | 0.248 | CYP2C19-substrate: | 0.102 |
CYP2C9-inhibitor: | 0.575 | CYP2C9-substrate: | 0.416 |
CYP2D6-inhibitor: | 0.59 | CYP2D6-substrate: | 0.289 |
CYP3A4-inhibitor: | 0.497 | CYP3A4-substrate: | 0.125 |
Clearance (CL): | 5.056 | Half-life (T1/2): | 0.377 |
hERG Blockers: | 0.013 | Human Hepatotoxicity (H-HT): | 0.342 |
Drug-inuced Liver Injury (DILI): | 0.933 | AMES Toxicity: | 0.837 |
Rat Oral Acute Toxicity: | 0.701 | Maximum Recommended Daily Dose: | 0.93 |
Skin Sensitization: | 0.925 | Carcinogencity: | 0.766 |
Eye Corrosion: | 0.009 | Eye Irritation: | 0.95 |
Respiratory Toxicity: | 0.516 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002239 | 0.652 | D0R3JB | 0.352 | ||||
ENC000337 | 0.576 | D0Y7PG | 0.342 | ||||
ENC000087 | 0.522 | D03GET | 0.333 | ||||
ENC004888 | 0.522 | D08FPM | 0.317 | ||||
ENC003447 | 0.473 | D08LFZ | 0.312 | ||||
ENC000094 | 0.472 | D04AIT | 0.310 | ||||
ENC000362 | 0.453 | D0K8KX | 0.302 | ||||
ENC000706 | 0.453 | D00KRE | 0.302 | ||||
ENC002296 | 0.452 | D0N1FS | 0.302 | ||||
ENC002766 | 0.442 | D07MGA | 0.299 |