|
Name |
Lanosteryl acetate
|
Molecular Formula | C32H52O2 | |
IUPAC Name* |
[(3S,5R,10S,13R,14R,17R)-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate
|
|
SMILES |
C[C@H](CCC=C(C)C)[C@H]1CC[C@@]2([C@@]1(CCC3=C2CC[C@@H]4[C@@]3(CC[C@@H](C4(C)C)OC(=O)C)C)C)C
|
|
InChI |
InChI=1S/C32H52O2/c1-21(2)11-10-12-22(3)24-15-19-32(9)26-13-14-27-29(5,6)28(34-23(4)33)17-18-30(27,7)25(26)16-20-31(24,32)8/h11,22,24,27-28H,10,12-20H2,1-9H3/t22-,24-,27+,28+,30-,31-,32+/m1/s1
|
|
InChIKey |
BQPPJGMMIYJVBR-VBGFMNGASA-N
|
|
Synonyms |
Lanosteryl acetate; Lanosterol acetate; 2671-68-3; 7LV3Y5V9QN; Lanosta-8,24-dien-3-ol, acetate, (3-beta)-; 3.beta.-Acetoxylanosta-8,24-diene; Lanosta-8,24-dien-3.beta.-yl acetate; Lanosta-8,24-dien-3.beta.-ol, acetate; Lanosta-8,24-dien-3-ol, acetate, (3.beta.)-; BRN 2512838; Lanosta-8,24-dien-3-ol, acetate, (3beta)-; Lanosta-8,24-dien-3-beta-ol, acetate; UNII-7LV3Y5V9QN; SCHEMBL415760; CHEMBL3138644; 8,24-LANOSTADIEN-3.BETA.-ACETATE; 3.BETA.-ACETOXY-5.ALPHA.-LANOSTA-8,24-DIENE; 5.ALPHA.-LANOST-8,24-DIENE-3.BETA.-YL ACETATE; LANOSTA-8,24-DIEN-3-OL, 3-ACETATE, (3.BETA.)-; (3S,5R,10S,13R,14R,17R)-4,4,10,13,14-pentamethyl-17-((R)-6-methylhept-5-en-2-yl)-2,3,4,5,6,7,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl acetate; [(3S,5R,10S,13R,14R,17R)-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate
|
|
CAS | 2671-68-3 | |
PubChem CID | 11190577 | |
ChEMBL ID | CHEMBL3138644 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 468.8 | ALogp: | 9.5 |
HBD: | 0 | HBA: | 2 |
Rotatable Bonds: | 6 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 26.3 | Aromatic Rings: | 4 |
Heavy Atoms: | 34 | QED Weighted: | 0.262 |
Caco-2 Permeability: | -4.873 | MDCK Permeability: | 0.00001400 |
Pgp-inhibitor: | 0.725 | Pgp-substrate: | 0 |
Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.962 |
30% Bioavailability (F30%): | 0.933 |
Blood-Brain-Barrier Penetration (BBB): | 0.01 | Plasma Protein Binding (PPB): | 92.46% |
Volume Distribution (VD): | 2.214 | Fu: | 1.25% |
CYP1A2-inhibitor: | 0.046 | CYP1A2-substrate: | 0.289 |
CYP2C19-inhibitor: | 0.155 | CYP2C19-substrate: | 0.969 |
CYP2C9-inhibitor: | 0.169 | CYP2C9-substrate: | 0.748 |
CYP2D6-inhibitor: | 0.053 | CYP2D6-substrate: | 0.406 |
CYP3A4-inhibitor: | 0.557 | CYP3A4-substrate: | 0.751 |
Clearance (CL): | 4.87 | Half-life (T1/2): | 0.017 |
hERG Blockers: | 0.024 | Human Hepatotoxicity (H-HT): | 0.243 |
Drug-inuced Liver Injury (DILI): | 0.376 | AMES Toxicity: | 0.001 |
Rat Oral Acute Toxicity: | 0.009 | Maximum Recommended Daily Dose: | 0.23 |
Skin Sensitization: | 0.919 | Carcinogencity: | 0.018 |
Eye Corrosion: | 0.9 | Eye Irritation: | 0.748 |
Respiratory Toxicity: | 0.341 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002075 | 0.618 | D0X7XG | 0.326 | ||||
ENC006069 | 0.528 | D03MTN | 0.293 | ||||
ENC006068 | 0.488 | D00AEQ | 0.290 | ||||
ENC001582 | 0.466 | D08TEJ | 0.284 | ||||
ENC001833 | 0.394 | D0Z1XD | 0.275 | ||||
ENC001745 | 0.375 | D02CJX | 0.275 | ||||
ENC003874 | 0.373 | D0Y7LD | 0.268 | ||||
ENC002686 | 0.373 | D0X4RS | 0.267 | ||||
ENC001949 | 0.361 | D0W5LS | 0.261 | ||||
ENC005963 | 0.348 | D0I2SD | 0.260 |