|
Name |
(2E,3Z)-2-Ethylidene-6-methyl-3,5-heptadienal
|
Molecular Formula | C10H14O | |
IUPAC Name* |
(2E,3Z)-2-ethylidene-6-methylhepta-3,5-dienal
|
|
SMILES |
C/C=C(\C=C/C=C(C)C)/C=O
|
|
InChI |
InChI=1S/C10H14O/c1-4-10(8-11)7-5-6-9(2)3/h4-8H,1-3H3/b7-5-,10-4+
|
|
InChIKey |
GNLLTRIMWRZWBF-ACUVPTBSSA-N
|
|
Synonyms |
3,5-Heptadienal, 2-ethylidene-6-methyl-; SCHEMBL12970010; (2E,3Z)-2-Ethylidene-6-methyl-3,5-heptadienal; (2E,3Z)-2-Ethylidene-6-methyl-3,5-heptadienal #
|
|
CAS | NA | |
PubChem CID | 5369968 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 150.22 | ALogp: | 2.8 |
HBD: | 0 | HBA: | 1 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 17.1 | Aromatic Rings: | 0 |
Heavy Atoms: | 11 | QED Weighted: | 0.342 |
Caco-2 Permeability: | -4.159 | MDCK Permeability: | 0.00002640 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.018 |
Human Intestinal Absorption (HIA): | 0.007 | 20% Bioavailability (F20%): | 0.002 |
30% Bioavailability (F30%): | 0.003 |
Blood-Brain-Barrier Penetration (BBB): | 0.911 | Plasma Protein Binding (PPB): | 88.41% |
Volume Distribution (VD): | 1.892 | Fu: | 7.70% |
CYP1A2-inhibitor: | 0.949 | CYP1A2-substrate: | 0.724 |
CYP2C19-inhibitor: | 0.347 | CYP2C19-substrate: | 0.879 |
CYP2C9-inhibitor: | 0.056 | CYP2C9-substrate: | 0.08 |
CYP2D6-inhibitor: | 0.071 | CYP2D6-substrate: | 0.248 |
CYP3A4-inhibitor: | 0.069 | CYP3A4-substrate: | 0.313 |
Clearance (CL): | 6.628 | Half-life (T1/2): | 0.771 |
hERG Blockers: | 0.009 | Human Hepatotoxicity (H-HT): | 0.166 |
Drug-inuced Liver Injury (DILI): | 0.117 | AMES Toxicity: | 0.131 |
Rat Oral Acute Toxicity: | 0.022 | Maximum Recommended Daily Dose: | 0.865 |
Skin Sensitization: | 0.929 | Carcinogencity: | 0.674 |
Eye Corrosion: | 0.966 | Eye Irritation: | 0.992 |
Respiratory Toxicity: | 0.957 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001732 | 0.571 | D02DGU | 0.239 | ||||
ENC005823 | 0.347 | D00DKK | 0.239 | ||||
ENC005822 | 0.347 | D0G3PI | 0.239 | ||||
ENC001629 | 0.333 | D0S7WX | 0.229 | ||||
ENC001434 | 0.318 | D05QDC | 0.224 | ||||
ENC001424 | 0.318 | D0B1IP | 0.207 | ||||
ENC005835 | 0.294 | D0F1GS | 0.179 | ||||
ENC001718 | 0.279 | D0Z4NI | 0.179 | ||||
ENC000313 | 0.278 | D0A7MY | 0.170 | ||||
ENC003852 | 0.274 | D0M1PQ | 0.170 |