|
Name |
2,6-Dimethyl-2,4,6-octatriene
|
Molecular Formula | C10H16 | |
IUPAC Name* |
(4E,6E)-2,6-dimethylocta-2,4,6-triene
|
|
SMILES |
C/C=C(\C)/C=C/C=C(C)C
|
|
InChI |
InChI=1S/C10H16/c1-5-10(4)8-6-7-9(2)3/h5-8H,1-4H3/b8-6+,10-5+
|
|
InChIKey |
GQVMHMFBVWSSPF-SOYUKNQTSA-N
|
|
Synonyms |
2,6-Dimethyl-2,4,6-octatriene; Alloocimene; 673-84-7; ALLO-OCIMENE; 3016-19-1; (4E,6E)-Alloocimene; trans,trans-Alloocimene; (4E,6E)-Allocimene; (4E,6E)-2,6-dimethylocta-2,4,6-triene; 2,6-Dimethylocta-2,4,6-triene; (E,E)-2,6-Dimethyl-2,4,6-octatriene; 2,4,6-Octatriene, 2,6-dimethyl-, (4E,6E)-; 2,4,6-Octatriene, 2,6-dimethyl-; 2,4,6-Octatriene, 2,6-dimethyl-, (E,E)-; trans-Alloocimene; (E,E)-2,6-Dimethylocta-2,4,6-triene; Alloocimene, (4E,6E)-; trans-allo-ocimene; 6TF53L340E; 2,6-Dimethyl-2,4E,6E-octatriene; DSSTox_CID_7288; DSSTox_RID_78388; DSSTox_GSID_27288; Allocymene; OCIMENE, ALLO; CAS-673-84-7; EINECS 211-614-5; EINECS 221-153-1; NSC 406263; Neoalloocimene; UNII-6TF53L340E; AI3-00737; Alloocimene I; NSC406263; cis-Allo-ocimene; ocimene (allo-); Z-Neo-allo-ocimene; (E,E)-allo-ocimene; ALLOOCIMENE A; trans,trans-allo-ocimene; Alloocimene, tech. grade; UNII-J9D0BS5BZN; (4E,6E)-allo-ocimene; J9D0BS5BZN; (E,E)-ALLOOCIMENE; OCIMENE, A110; 4-trans-6-trans-alloocimene; ALLOCYMENE APPROX.80%; CHEMBL2268552; CHEBI:90064; DTXSID00883936; CHEBI:141222; ZINC1599076; Tox21_202278; Tox21_303244; BBL027750; LMFA11000042; MFCD00009278; STL146333; AKOS005720971; NSC-406263; NCGC00249203-01; NCGC00257015-01; NCGC00259827-01; (2E)-3,7-Dimethyl-2,4,6-octatriene; (2Z)-3,7-Dimethyl-2,4,6-octatriene; VS-08587; 2,6-Dimethyl-octa-2,4,6-triene, trans; 2,6-Octatriene, 2,6-dimethyl- (VAN8C; 2,6-dimethyl-octa-2,4trans,6trans-triene; (4E,6E)-2,6-Dimethyl-2,4,6-octatriene; 2,4,6-Octatriene, 2,6-dimethyl- (VAN); D1277; 2,6-Dimethyl-2,4,6-octatriene, mixture of isomers; W-109590; W-109849; Q15628365; 2,6-Dimethyl-2,4,6-octatriene, technical grade, 80%
|
|
CAS | 3016-19-1 | |
PubChem CID | 5368821 | |
ChEMBL ID | CHEMBL2268552 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 136.23 | ALogp: | 4.2 |
HBD: | 0 | HBA: | 0 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 0.0 | Aromatic Rings: | 0 |
Heavy Atoms: | 10 | QED Weighted: | 0.499 |
Caco-2 Permeability: | -4.188 | MDCK Permeability: | 0.00001990 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.006 |
Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.003 |
30% Bioavailability (F30%): | 0.01 |
Blood-Brain-Barrier Penetration (BBB): | 0.838 | Plasma Protein Binding (PPB): | 89.10% |
Volume Distribution (VD): | 1.624 | Fu: | 18.23% |
CYP1A2-inhibitor: | 0.833 | CYP1A2-substrate: | 0.959 |
CYP2C19-inhibitor: | 0.559 | CYP2C19-substrate: | 0.942 |
CYP2C9-inhibitor: | 0.121 | CYP2C9-substrate: | 0.975 |
CYP2D6-inhibitor: | 0.785 | CYP2D6-substrate: | 0.932 |
CYP3A4-inhibitor: | 0.03 | CYP3A4-substrate: | 0.404 |
Clearance (CL): | 5.741 | Half-life (T1/2): | 0.734 |
hERG Blockers: | 0.013 | Human Hepatotoxicity (H-HT): | 0.068 |
Drug-inuced Liver Injury (DILI): | 0.042 | AMES Toxicity: | 0.009 |
Rat Oral Acute Toxicity: | 0.013 | Maximum Recommended Daily Dose: | 0.705 |
Skin Sensitization: | 0.922 | Carcinogencity: | 0.392 |
Eye Corrosion: | 0.978 | Eye Irritation: | 0.995 |
Respiratory Toxicity: | 0.279 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001740 | 0.571 | D0S7WX | 0.277 | ||||
ENC001718 | 0.368 | D0G3PI | 0.269 | ||||
ENC001568 | 0.333 | D02DGU | 0.269 | ||||
ENC000526 | 0.333 | D00DKK | 0.269 | ||||
ENC001629 | 0.323 | D05QDC | 0.250 | ||||
ENC003853 | 0.317 | D0B1IP | 0.231 | ||||
ENC003854 | 0.317 | D0M1PQ | 0.209 | ||||
ENC003852 | 0.310 | D05XQE | 0.194 | ||||
ENC001424 | 0.310 | D09XWD | 0.182 | ||||
ENC001434 | 0.310 | D0MY8N | 0.162 |