|
Name |
9(11)-Dehydroergosteryl benzoate
|
Molecular Formula | C35H46O2 | |
IUPAC Name* |
[17-[(E)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,12,14,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-3-yl] benzoate
|
|
SMILES |
CC(C)C(C)/C=C/C(C)C1CCC2C1(CC=C3C2=CC=C4C3(CCC(C4)OC(=O)C5=CC=CC=C5)C)C
|
|
InChI |
InChI=1S/C35H46O2/c1-23(2)24(3)12-13-25(4)30-16-17-31-29-15-14-27-22-28(37-33(36)26-10-8-7-9-11-26)18-20-34(27,5)32(29)19-21-35(30,31)6/h7-15,19,23-25,28,30-31H,16-18,20-22H2,1-6H3/b13-12+
|
|
InChIKey |
QDPXAUKTOSGGPE-OUKQBFOZSA-N
|
|
Synonyms |
9(11)-Dehydroergosteryl benzoate; (22E)-Ergosta-5,7,9(11),22-tetraen-3-yl benzoate #
|
|
CAS | NA | |
PubChem CID | 5366124 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 498.7 | ALogp: | 9.1 |
HBD: | 0 | HBA: | 2 |
Rotatable Bonds: | 7 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 26.3 | Aromatic Rings: | 5 |
Heavy Atoms: | 37 | QED Weighted: | 0.253 |
Caco-2 Permeability: | -4.9 | MDCK Permeability: | 0.00000596 |
Pgp-inhibitor: | 1 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.02 | 20% Bioavailability (F20%): | 0.698 |
30% Bioavailability (F30%): | 0.597 |
Blood-Brain-Barrier Penetration (BBB): | 0.002 | Plasma Protein Binding (PPB): | 101.52% |
Volume Distribution (VD): | 2.778 | Fu: | 1.66% |
CYP1A2-inhibitor: | 0.043 | CYP1A2-substrate: | 0.249 |
CYP2C19-inhibitor: | 0.334 | CYP2C19-substrate: | 0.961 |
CYP2C9-inhibitor: | 0.128 | CYP2C9-substrate: | 0.463 |
CYP2D6-inhibitor: | 0.264 | CYP2D6-substrate: | 0.355 |
CYP3A4-inhibitor: | 0.545 | CYP3A4-substrate: | 0.916 |
Clearance (CL): | 1.761 | Half-life (T1/2): | 0.019 |
hERG Blockers: | 0.105 | Human Hepatotoxicity (H-HT): | 0.21 |
Drug-inuced Liver Injury (DILI): | 0.035 | AMES Toxicity: | 0.017 |
Rat Oral Acute Toxicity: | 0.903 | Maximum Recommended Daily Dose: | 0.745 |
Skin Sensitization: | 0.181 | Carcinogencity: | 0.136 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.007 |
Respiratory Toxicity: | 0.943 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002400 | 0.695 | D06JPB | 0.363 | ||||
ENC004739 | 0.484 | D0G8OC | 0.363 | ||||
ENC006033 | 0.453 | D0G5CF | 0.348 | ||||
ENC004738 | 0.449 | D06CNP | 0.299 | ||||
ENC001092 | 0.449 | D06CWH | 0.277 | ||||
ENC005258 | 0.449 | D08MRN | 0.272 | ||||
ENC005707 | 0.449 | D04XPW | 0.267 | ||||
ENC002665 | 0.438 | D06PTA | 0.267 | ||||
ENC006032 | 0.417 | D0S0AS | 0.267 | ||||
ENC004906 | 0.410 | D0N1TP | 0.265 |