NPs Basic Information
|
Name |
(22E, 24R)-ergosta-5,7,22-trien-3β-ol
|
| Molecular Formula | C28H44O | |
| IUPAC Name* |
17-(5,6-dimethylhept-3-en-2-yl)-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol
|
|
| SMILES |
CC(C)C(C)C=CC(C)C1CCC2C3=CC=C4CC(O)CCC4(C)C3CCC21C
|
|
| InChI |
InChI=1S/C28H44O/c1-18(2)19(3)7-8-20(4)24-11-12-25-23-10-9-21-17-22(29)13-15-27(21,5)26(23)14-16-28(24,25)6/h7-10,18-20,22,24-26,29H,11-17H2,1-6H3/b8-7+/t19-,20+,22-,24+,25-,26-,27-,28+/m0/s1
|
|
| InChIKey |
DNVPQKQSNYMLRS-APGDWVJJSA-N
|
|
| Synonyms |
NA
|
|
| CAS | NA | |
| PubChem CID | NA | |
| ChEMBL ID | NA |
*Note: the IUPAC Name was calculated by STOUT. Reference: PMID:33906675.
Chemical Classification: |
|
|
|---|
——————————————————————————————————————————
NPs Species Source
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
NPs Biological Activity
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
NPs Physi-Chem Properties
| Molecular Weight: | 396.66 | ALogp: | 7.3 |
| HBD: | 1 | HBA: | 1 |
| Rotatable Bonds: | 4 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 20.2 | Aromatic Rings: | 4 |
| Heavy Atoms: | 29 | QED Weighted: | 0.491 |
——————————————————————————————————————————
NPs ADMET Properties*
ADMET: Absorption
| Caco-2 Permeability: | -4.747 | MDCK Permeability: | 0.00000885 |
| Pgp-inhibitor: | 0.982 | Pgp-substrate: | 0.009 |
| Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.006 |
| 30% Bioavailability (F30%): | 0.511 |
——————————————————————————————————————————
ADMET: Distribution
| Blood-Brain-Barrier Penetration (BBB): | 0.62 | Plasma Protein Binding (PPB): | 99.84% |
| Volume Distribution (VD): | 1.386 | Fu: | 1.63% |
——————————————————————————————————————————
ADMET: Metabolism
| CYP1A2-inhibitor: | 0.041 | CYP1A2-substrate: | 0.501 |
| CYP2C19-inhibitor: | 0.052 | CYP2C19-substrate: | 0.971 |
| CYP2C9-inhibitor: | 0.121 | CYP2C9-substrate: | 0.084 |
| CYP2D6-inhibitor: | 0.014 | CYP2D6-substrate: | 0.29 |
| CYP3A4-inhibitor: | 0.255 | CYP3A4-substrate: | 0.919 |
——————————————————————————————————————————
ADMET: Excretion
| Clearance (CL): | 15.231 | Half-life (T1/2): | 0.028 |
——————————————————————————————————————————
ADMET: Toxicity
| hERG Blockers: | 0.013 | Human Hepatotoxicity (H-HT): | 0.01 |
| Drug-inuced Liver Injury (DILI): | 0.021 | AMES Toxicity: | 0.038 |
| Rat Oral Acute Toxicity: | 0.474 | Maximum Recommended Daily Dose: | 0.612 |
| Skin Sensitization: | 0.077 | Carcinogencity: | 0.066 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.012 |
| Respiratory Toxicity: | 0.911 |
——————————————————————————————————————————
*Note: the ADMET properties was calculated by ADMETlab 2.0. Reference: PMID: 33893803.
Similar Compounds*
Compounds similar to EMNPD with top10 similarity:
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
 |
D0G8OC |  |
0.553 | ||||
|
D06JPB |  |
0.509 | ||||
|
D0G5CF |  |
0.486 | ||||
|
D0Y7LD |  |
0.442 | ||||
|
D0N1TP |  |
0.385 | ||||
|
D0B4RU |  |
0.358 | ||||
|
D01QUS |  |
0.358 | ||||
|
D0K5WS |  |
0.339 | ||||
|
D08SVH |  |
0.339 | ||||
|
D0K0EK |  |
0.337 | ||||