|
Name |
[4-Amino-2-(benzylamino)-1,3-thiazol-5-yl](4-fluorophenyl)methanone
|
Molecular Formula | C17H14FN3OS | |
IUPAC Name* |
[4-amino-2-(benzylamino)-1,3-thiazol-5-yl]-(4-fluorophenyl)methanone
|
|
SMILES |
C1=CC=C(C=C1)CNC2=NC(=C(S2)C(=O)C3=CC=C(C=C3)F)N
|
|
InChI |
InChI=1S/C17H14FN3OS/c18-13-8-6-12(7-9-13)14(22)15-16(19)21-17(23-15)20-10-11-4-2-1-3-5-11/h1-9H,10,19H2,(H,20,21)
|
|
InChIKey |
JFBJKTYJJCAKHN-UHFFFAOYSA-N
|
|
Synonyms |
[4-amino-2-(benzylamino)-1,3-thiazol-5-yl](4-fluorophenyl)methanone; ZINC4722374; STK781672; AKOS001754627; NCGC00318368-01; AB01311719-01; Methanone, [4-amino-2-[(phenylmethyl)amino]-5-thiazolyl](4-fluorophenyl)-
|
|
CAS | NA | |
PubChem CID | 5297493 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 327.4 | ALogp: | 4.7 |
HBD: | 2 | HBA: | 6 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 96.2 | Aromatic Rings: | 3 |
Heavy Atoms: | 23 | QED Weighted: | 0.682 |
Caco-2 Permeability: | -4.881 | MDCK Permeability: | 0.00002400 |
Pgp-inhibitor: | 0.471 | Pgp-substrate: | 0.959 |
Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.002 |
30% Bioavailability (F30%): | 0.013 |
Blood-Brain-Barrier Penetration (BBB): | 0.853 | Plasma Protein Binding (PPB): | 96.89% |
Volume Distribution (VD): | 0.784 | Fu: | 3.30% |
CYP1A2-inhibitor: | 0.967 | CYP1A2-substrate: | 0.66 |
CYP2C19-inhibitor: | 0.956 | CYP2C19-substrate: | 0.058 |
CYP2C9-inhibitor: | 0.906 | CYP2C9-substrate: | 0.027 |
CYP2D6-inhibitor: | 0.918 | CYP2D6-substrate: | 0.127 |
CYP3A4-inhibitor: | 0.916 | CYP3A4-substrate: | 0.252 |
Clearance (CL): | 7.571 | Half-life (T1/2): | 0.036 |
hERG Blockers: | 0.039 | Human Hepatotoxicity (H-HT): | 0.949 |
Drug-inuced Liver Injury (DILI): | 0.979 | AMES Toxicity: | 0.85 |
Rat Oral Acute Toxicity: | 0.161 | Maximum Recommended Daily Dose: | 0.942 |
Skin Sensitization: | 0.099 | Carcinogencity: | 0.744 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.406 |
Respiratory Toxicity: | 0.064 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001400 | 0.391 | D0X7GL | 0.391 | ||||
ENC000209 | 0.386 | D0YB1G | 0.372 | ||||
ENC000302 | 0.356 | D02IHW | 0.352 | ||||
ENC000077 | 0.345 | D0Y7EM | 0.349 | ||||
ENC000093 | 0.338 | D03CJL | 0.349 | ||||
ENC001449 | 0.330 | D06LHG | 0.348 | ||||
ENC001352 | 0.319 | D0G1VX | 0.345 | ||||
ENC001291 | 0.319 | D0J1MI | 0.344 | ||||
ENC000908 | 0.318 | D0H6TP | 0.341 | ||||
ENC003516 | 0.315 | D0X5UN | 0.336 |