|
Name |
Ethyl tiglate
|
Molecular Formula | C7H12O2 | |
IUPAC Name* |
ethyl (E)-2-methylbut-2-enoate
|
|
SMILES |
CCOC(=O)/C(=C/C)/C
|
|
InChI |
InChI=1S/C7H12O2/c1-4-6(3)7(8)9-5-2/h4H,5H2,1-3H3/b6-4+
|
|
InChIKey |
OAPHLAAOJMTMLY-GQCTYLIASA-N
|
|
Synonyms |
Ethyl tiglate; 5837-78-5; Ethyl 2-methylcrotonate; Tiglic acid, ethyl ester; ethyl (E)-2-methylbut-2-enoate; Ethyl trans-2-methyl-2-butenoate; Ethyl alpha-methylcrotonate; (E)-2-Methyl-2-butenoic acid ethyl ester; 2-Butenoic acid, 2-methyl-, ethyl ester, (2E)-; Ethyl (E)-2-methylcrotonate; Ethyl trans-2-methylcrotonate; FEMA No. 2460; Tiglic acid ethyl ester; Ethyl 2-methylbut-2-enoate; Ethyl (E)-2-methyl-2-butenoate; ETHYLTIGLATE; 2-Butenoic acid, 2-methyl-, ethyl ester, (E)-; 2-Butenoic acid, 2-methyl-, ethyl ester; (E)-ethyl 2-methylbut-2-enoate; Crotonic acid, 2-methyl-, ethyl ester, (E)-; CHEBI:4892; 0MQ7E9082G; ethyl (2E)-2-methylbut-2-enoate; Ethyl (2E)-2-methyl-2-butenoate; NSC-55278; Ethyl 2-methyl-2-butenoate; Ethyl 2-methylcrotonate, (E)-; EINECS 227-425-6; Ethyl 2-methyl-2-butenoate, (E)-; NSC 55278; BRN 1720895; UNII-0MQ7E9082G; (E)-ethyl tiglate; Tiglic acid, ethyl ester (6CI,7CI); Ethyl tiglate, >=98%; Ethyl alpha -methylcrotonate; Ethyl-2-methylbut-2-enoate; ETHYL TIGLATE [FHFI]; (E)-Ethyl 2-methylcrotonate; SCHEMBL111293; CHEMBL299599; Ethyl tiglate, >=98%, FG; (E)-ethyl2-methylbut-2-enoate; DTXSID8047688; FEMA 2460; (E)-Ethyl 2-methyl-2-butenoate; ZINC897516; NSC55278; LMFA07010884; MFCD00015183; 2-Methyl-2-butenoic acid ethyl ester; AKOS015903267; 2-Methyl-ethyl ester(E)-Crotonic acid; 2-Methyl-ethyl ester(E)-2-Butenoic acid; LS-13312; 2-Methyl-ethyl ester(2E)-2-Butenoic acid; 2-methyl-trans-but-2-enoic acid ethyl ester; CS-0186102; T0247; Ethyl tiglate stabilized with alpha-tocopherol; (E)-2-butenoic acid, 2-methyl-, ethyl ester; C08487; D94746; Q27106534
|
|
CAS | 5837-78-5 | |
PubChem CID | 5281163 | |
ChEMBL ID | CHEMBL299599 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 128.17 | ALogp: | 1.7 |
HBD: | 0 | HBA: | 2 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 26.3 | Aromatic Rings: | 0 |
Heavy Atoms: | 9 | QED Weighted: | 0.42 |
Caco-2 Permeability: | -4.176 | MDCK Permeability: | 0.00002830 |
Pgp-inhibitor: | 0.003 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.002 | 20% Bioavailability (F20%): | 0.849 |
30% Bioavailability (F30%): | 0.984 |
Blood-Brain-Barrier Penetration (BBB): | 0.731 | Plasma Protein Binding (PPB): | 64.83% |
Volume Distribution (VD): | 1.22 | Fu: | 47.23% |
CYP1A2-inhibitor: | 0.959 | CYP1A2-substrate: | 0.931 |
CYP2C19-inhibitor: | 0.773 | CYP2C19-substrate: | 0.809 |
CYP2C9-inhibitor: | 0.236 | CYP2C9-substrate: | 0.262 |
CYP2D6-inhibitor: | 0.18 | CYP2D6-substrate: | 0.234 |
CYP3A4-inhibitor: | 0.058 | CYP3A4-substrate: | 0.315 |
Clearance (CL): | 9.48 | Half-life (T1/2): | 0.794 |
hERG Blockers: | 0.021 | Human Hepatotoxicity (H-HT): | 0.018 |
Drug-inuced Liver Injury (DILI): | 0.126 | AMES Toxicity: | 0.015 |
Rat Oral Acute Toxicity: | 0.02 | Maximum Recommended Daily Dose: | 0.027 |
Skin Sensitization: | 0.722 | Carcinogencity: | 0.134 |
Eye Corrosion: | 0.961 | Eye Irritation: | 0.992 |
Respiratory Toxicity: | 0.26 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000410 | 0.536 | D0ZK8H | 0.303 | ||||
ENC000312 | 0.462 | D0Q9HF | 0.263 | ||||
ENC000879 | 0.429 | D02CKX | 0.250 | ||||
ENC000415 | 0.419 | D0U7BW | 0.231 | ||||
ENC000186 | 0.387 | D0J5DC | 0.222 | ||||
ENC000224 | 0.367 | D04MWJ | 0.220 | ||||
ENC000241 | 0.353 | D0Q8ZX | 0.217 | ||||
ENC001463 | 0.351 | D0K3LW | 0.217 | ||||
ENC000758 | 0.333 | D0FM2P | 0.216 | ||||
ENC000226 | 0.333 | D0Q6DX | 0.216 |