|
Name |
Ethyl pyruvate
|
Molecular Formula | C5H8O3 | |
IUPAC Name* |
ethyl 2-oxopropanoate
|
|
SMILES |
CCOC(=O)C(=O)C
|
|
InChI |
InChI=1S/C5H8O3/c1-3-8-5(7)4(2)6/h3H2,1-2H3
|
|
InChIKey |
XXRCUYVCPSWGCC-UHFFFAOYSA-N
|
|
Synonyms |
ETHYL PYRUVATE; Ethyl 2-oxopropanoate; 617-35-6; Ethyl 2-oxopropionate; Pyruvic acid, ethyl ester; Propanoic acid, 2-oxo-, ethyl ester; PYRUVIC ACID ETHYL ESTER; Ethyl pyroracemate; Ethyl acetylformate; FEMA No. 2457; CTI-01; Ethyl alpha-ketopropionate; 2-Oxo-propionic acid ethyl ester; 2-oxopropanoic acid ethyl ester; Ethyl methylglyoxylate; NSC-48386; 2-oxopropionic acid ethyl ester; 03O98E01OB; Ethyl pyruvate (natural); CCRIS 4651; EINECS 210-511-2; NSC 48386; UNII-03O98E01OB; AI3-05636; MFCD00009123; ethyl-2-oxopropanoate; ethyl 2-oxo-propionate; Ethyl pyruvate, 98%; Ethyl pyruvate, >=97%; Ethyl pyruvate-1-[13C]; Ethyl pyruvate-2-[13C]; Ethyl pyruvate-3-[13C]; SCHEMBL25538; ETHYL PYRUVATE [FHFI]; ETHYL PYRUVATE [INCI]; ethyl 2-oxidanylidenepropanoate; CHEMBL173373; Ethyl pyruvate, >=97%, FG; DTXSID2060674; FEMA 2457; CHEBI:173421; Pyruvic acid, ethyl ester (8CI); Ethyl pyruvate, analytical standard; AMY40824; HY-Y1362; NSC48386; ZINC1679741; BBL027737; s6243; STK802375; AKOS000119054; PYRUVIC ACID ETHYL ESTER [MI]; DB05869; Ethyl pyruvate, natural, >=95%, FG; CS-0017821; FT-0625792; FT-0674254; P0891; EN300-18982; D72526; E-8500; A833398; Q15632706; F0001-1639; Z104472090; 9X7; Ethyl 2-oxopropanoate, Ethyl 2-oxopropionate, Ethyl acetylformate, Ethyl alpha-ketopropionate, Ethyl pyroracemate
|
|
CAS | 617-35-6 | |
PubChem CID | 12041 | |
ChEMBL ID | CHEMBL173373 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 116.11 | ALogp: | 0.4 |
HBD: | 0 | HBA: | 3 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 43.4 | Aromatic Rings: | 0 |
Heavy Atoms: | 8 | QED Weighted: | 0.39 |
Caco-2 Permeability: | -4.334 | MDCK Permeability: | 0.00006990 |
Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0 |
Human Intestinal Absorption (HIA): | 0.003 | 20% Bioavailability (F20%): | 0.67 |
30% Bioavailability (F30%): | 0.978 |
Blood-Brain-Barrier Penetration (BBB): | 0.88 | Plasma Protein Binding (PPB): | 34.10% |
Volume Distribution (VD): | 0.333 | Fu: | 64.15% |
CYP1A2-inhibitor: | 0.872 | CYP1A2-substrate: | 0.834 |
CYP2C19-inhibitor: | 0.271 | CYP2C19-substrate: | 0.718 |
CYP2C9-inhibitor: | 0.034 | CYP2C9-substrate: | 0.19 |
CYP2D6-inhibitor: | 0.01 | CYP2D6-substrate: | 0.277 |
CYP3A4-inhibitor: | 0.008 | CYP3A4-substrate: | 0.293 |
Clearance (CL): | 7.243 | Half-life (T1/2): | 0.803 |
hERG Blockers: | 0.021 | Human Hepatotoxicity (H-HT): | 0.012 |
Drug-inuced Liver Injury (DILI): | 0.159 | AMES Toxicity: | 0.139 |
Rat Oral Acute Toxicity: | 0.017 | Maximum Recommended Daily Dose: | 0.01 |
Skin Sensitization: | 0.733 | Carcinogencity: | 0.034 |
Eye Corrosion: | 0.989 | Eye Irritation: | 0.992 |
Respiratory Toxicity: | 0.198 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000403 | 0.542 | D0G4JI | 0.375 | ||||
ENC001556 | 0.536 | D0F1GS | 0.321 | ||||
ENC000312 | 0.522 | D0Z4NI | 0.321 | ||||
ENC000758 | 0.441 | D0ZK8H | 0.290 | ||||
ENC000224 | 0.407 | D02CKX | 0.268 | ||||
ENC001794 | 0.390 | D0Q6DX | 0.255 | ||||
ENC000186 | 0.379 | D0Y4AW | 0.255 | ||||
ENC000061 | 0.375 | D06XGW | 0.250 | ||||
ENC000415 | 0.367 | D0Q9HF | 0.250 | ||||
ENC000226 | 0.367 | D0K3LW | 0.250 |