|
Name |
4-Hydroxy-4-(3-pyridyl)-butanoate
|
Molecular Formula | C9H10NO3- | |
IUPAC Name* |
4-hydroxy-4-pyridin-3-ylbutanoate
|
|
SMILES |
C1=CC(=CN=C1)C(CCC(=O)[O-])O
|
|
InChI |
InChI=1S/C9H11NO3/c11-8(3-4-9(12)13)7-2-1-5-10-6-7/h1-2,5-6,8,11H,3-4H2,(H,12,13)/p-1
|
|
InChIKey |
STZOZPPVGWNSMC-UHFFFAOYSA-M
|
|
Synonyms |
4-hydroxy-4-(3-pyridyl)-butanoate; gamma-(3-pyridyl)-gamma-hydroxybutyric acid; 1-(3-Pyridyl)-1-butanol-4-carboxylic Acid Na+/NH4+ Salt
|
|
CAS | NA | |
PubChem CID | 4394792 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 180.18 | ALogp: | 0.5 |
HBD: | 1 | HBA: | 4 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 73.2 | Aromatic Rings: | 1 |
Heavy Atoms: | 13 | QED Weighted: | 0.711 |
Caco-2 Permeability: | -5.566 | MDCK Permeability: | 0.00002560 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.004 |
Human Intestinal Absorption (HIA): | 0.176 | 20% Bioavailability (F20%): | 0.037 |
30% Bioavailability (F30%): | 0.918 |
Blood-Brain-Barrier Penetration (BBB): | 0.425 | Plasma Protein Binding (PPB): | 19.80% |
Volume Distribution (VD): | 0.385 | Fu: | 74.50% |
CYP1A2-inhibitor: | 0.016 | CYP1A2-substrate: | 0.439 |
CYP2C19-inhibitor: | 0.025 | CYP2C19-substrate: | 0.074 |
CYP2C9-inhibitor: | 0.004 | CYP2C9-substrate: | 0.924 |
CYP2D6-inhibitor: | 0.004 | CYP2D6-substrate: | 0.209 |
CYP3A4-inhibitor: | 0.016 | CYP3A4-substrate: | 0.093 |
Clearance (CL): | 3.89 | Half-life (T1/2): | 0.732 |
hERG Blockers: | 0.035 | Human Hepatotoxicity (H-HT): | 0.13 |
Drug-inuced Liver Injury (DILI): | 0.301 | AMES Toxicity: | 0.012 |
Rat Oral Acute Toxicity: | 0.029 | Maximum Recommended Daily Dose: | 0.671 |
Skin Sensitization: | 0.466 | Carcinogencity: | 0.124 |
Eye Corrosion: | 0.005 | Eye Irritation: | 0.442 |
Respiratory Toxicity: | 0.035 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002450 | 0.522 | D06NVJ | 0.419 | ||||
ENC000048 | 0.386 | D0O2SR | 0.345 | ||||
ENC001033 | 0.309 | D0P2GK | 0.315 | ||||
ENC002540 | 0.288 | D0PA5S | 0.270 | ||||
ENC000173 | 0.280 | D0T8LY | 0.267 | ||||
ENC002111 | 0.276 | D0TY5N | 0.259 | ||||
ENC000056 | 0.271 | D0O6IU | 0.255 | ||||
ENC000004 | 0.264 | D0Q9JT | 0.254 | ||||
ENC001450 | 0.259 | D09PNY | 0.247 | ||||
ENC001819 | 0.255 | D05QIM | 0.246 |