|
Name |
[1,2,4]Oxadiazole, 5-benzyl-3-(thiophen-2-yl)-
|
Molecular Formula | C13H10N2OS | |
IUPAC Name* |
5-benzyl-3-thiophen-2-yl-1,2,4-oxadiazole
|
|
SMILES |
C1=CC=C(C=C1)CC2=NC(=NO2)C3=CC=CS3
|
|
InChI |
InChI=1S/C13H10N2OS/c1-2-5-10(6-3-1)9-12-14-13(15-16-12)11-7-4-8-17-11/h1-8H,9H2
|
|
InChIKey |
WSHBYOOZHQPVSF-UHFFFAOYSA-N
|
|
Synonyms |
ZINC1420884; STK791809; AKOS005613148; 5-benzyl-3-(2-thienyl)-1,2,4-oxadiazole; 5-benzyl-3-(thiophen-2-yl)-1,2,4-oxadiazole; [1,2,4]Oxadiazole, 5-benzyl-3-(thiophen-2-yl)-
|
|
CAS | NA | |
PubChem CID | 1502137 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 242.3 | ALogp: | 3.5 |
HBD: | 0 | HBA: | 4 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 67.2 | Aromatic Rings: | 3 |
Heavy Atoms: | 17 | QED Weighted: | 0.692 |
Caco-2 Permeability: | -4.344 | MDCK Permeability: | 0.00004130 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0 |
Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.293 |
30% Bioavailability (F30%): | 0.396 |
Blood-Brain-Barrier Penetration (BBB): | 0.768 | Plasma Protein Binding (PPB): | 97.01% |
Volume Distribution (VD): | 1.244 | Fu: | 1.37% |
CYP1A2-inhibitor: | 0.984 | CYP1A2-substrate: | 0.403 |
CYP2C19-inhibitor: | 0.953 | CYP2C19-substrate: | 0.067 |
CYP2C9-inhibitor: | 0.932 | CYP2C9-substrate: | 0.313 |
CYP2D6-inhibitor: | 0.442 | CYP2D6-substrate: | 0.168 |
CYP3A4-inhibitor: | 0.558 | CYP3A4-substrate: | 0.639 |
Clearance (CL): | 3.435 | Half-life (T1/2): | 0.323 |
hERG Blockers: | 0.008 | Human Hepatotoxicity (H-HT): | 0.892 |
Drug-inuced Liver Injury (DILI): | 0.982 | AMES Toxicity: | 0.559 |
Rat Oral Acute Toxicity: | 0.111 | Maximum Recommended Daily Dose: | 0.032 |
Skin Sensitization: | 0.226 | Carcinogencity: | 0.236 |
Eye Corrosion: | 0.006 | Eye Irritation: | 0.513 |
Respiratory Toxicity: | 0.985 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005617 | 0.415 | D0KS6W | 0.342 | ||||
ENC000209 | 0.351 | D03RZV | 0.338 | ||||
ENC000908 | 0.347 | D0H6TP | 0.338 | ||||
ENC003032 | 0.329 | D0I2VK | 0.333 | ||||
ENC000321 | 0.328 | D0G1VX | 0.324 | ||||
ENC000077 | 0.324 | D05OIS | 0.321 | ||||
ENC000036 | 0.324 | D01AXB | 0.314 | ||||
ENC000014 | 0.321 | D0B4JQ | 0.309 | ||||
ENC000205 | 0.321 | D0M9DC | 0.307 | ||||
ENC000203 | 0.321 | D06FZX | 0.306 |