|
Name |
Dibenzofuran
|
Molecular Formula | C12H8O | |
IUPAC Name* |
dibenzofuran
|
|
SMILES |
C1=CC=C2C(=C1)C3=CC=CC=C3O2
|
|
InChI |
InChI=1S/C12H8O/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11/h1-8H
|
|
InChIKey |
TXCDCPKCNAJMEE-UHFFFAOYSA-N
|
|
Synonyms |
dibenzofuran; Dibenzo[b,d]furan; 132-64-9; diphenylene oxide; Dibenzofurans; 2,2'-Biphenylene oxide; 2,2'-Biphenylylene oxide; Dibenzo(b,d)furan; dibenzofurane; (1,1'-Biphenyl)-2,2'-diyl oxide; [1,1'-Biphenyl]-2,2'-diyl oxide; CHEBI:28145; 8U54U639VI; NSC-1245; DSSTox_CID_1993; DSSTox_RID_76446; DSSTox_GSID_21993; Dibenzol(b,d)furan; 102250-99-7; CAS-132-64-9; CCRIS 1436; HSDB 2163; NSC 1245; EINECS 205-071-3; UNII-8U54U639VI; AI3-00039; Dibenzo[b]furan; dibenzo[bd]furan; Dibenzofuran, 98%; [1,2'-diyl oxide; DIBENZOFURAN [MI]; bmse000548; DIBENZOFURAN [HSDB]; SCHEMBL8207; CHEMBL277497; DTXSID2021993; Dibenzofuran, analytical standard; NSC1245; DIBENZO (b,d) FURAN (purity); ZINC3861058; Tox21_202116; Tox21_300052; BDBM50408362; MFCD00004968; STL185574; AKOS000120971; CS-W017802; PS-5378; NCGC00164102-01; NCGC00164102-02; NCGC00164102-03; NCGC00254221-01; NCGC00259665-01; AC-19766; DB-042123; D0147; FT-0624634; EN300-18022; C07729; Q419513; Q-101160; Z57127512; Dibenzo[b,d]furan, BCR(R) certified Reference Material; 8-oxatricyclo[7.4.0.0,2,7]trideca-1(9),2(7),3,5,10,12-hexaene; 8-oxatricyclo[7.4.0.0^{2,7}]trideca-1(9),2(7),3,5,10,12-hexaene; 1IT
|
|
CAS | 132-64-9 | |
PubChem CID | 568 | |
ChEMBL ID | CHEMBL277497 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 168.19 | ALogp: | 4.1 |
HBD: | 0 | HBA: | 1 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 13.1 | Aromatic Rings: | 3 |
Heavy Atoms: | 13 | QED Weighted: | 0.487 |
Caco-2 Permeability: | -4.611 | MDCK Permeability: | 0.00001950 |
Pgp-inhibitor: | 0.035 | Pgp-substrate: | 0.16 |
Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.996 |
30% Bioavailability (F30%): | 0.994 |
Blood-Brain-Barrier Penetration (BBB): | 0.266 | Plasma Protein Binding (PPB): | 95.99% |
Volume Distribution (VD): | 1.03 | Fu: | 4.38% |
CYP1A2-inhibitor: | 0.995 | CYP1A2-substrate: | 0.648 |
CYP2C19-inhibitor: | 0.825 | CYP2C19-substrate: | 0.388 |
CYP2C9-inhibitor: | 0.361 | CYP2C9-substrate: | 0.868 |
CYP2D6-inhibitor: | 0.433 | CYP2D6-substrate: | 0.906 |
CYP3A4-inhibitor: | 0.113 | CYP3A4-substrate: | 0.242 |
Clearance (CL): | 8.014 | Half-life (T1/2): | 0.221 |
hERG Blockers: | 0.093 | Human Hepatotoxicity (H-HT): | 0.154 |
Drug-inuced Liver Injury (DILI): | 0.915 | AMES Toxicity: | 0.81 |
Rat Oral Acute Toxicity: | 0.251 | Maximum Recommended Daily Dose: | 0.112 |
Skin Sensitization: | 0.776 | Carcinogencity: | 0.87 |
Eye Corrosion: | 0.434 | Eye Irritation: | 0.995 |
Respiratory Toxicity: | 0.693 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000047 | 0.468 | D02TJS | 0.486 | ||||
ENC000171 | 0.446 | D0QV5T | 0.456 | ||||
ENC000159 | 0.444 | D0B1FE | 0.433 | ||||
ENC002806 | 0.431 | D0E3OF | 0.425 | ||||
ENC000737 | 0.429 | D08FTG | 0.375 | ||||
ENC000167 | 0.420 | D04MSM | 0.358 | ||||
ENC000025 | 0.420 | D0Y0JH | 0.353 | ||||
ENC000321 | 0.408 | D04QZD | 0.348 | ||||
ENC002323 | 0.407 | D0QL3P | 0.348 | ||||
ENC000732 | 0.387 | D0G1VX | 0.344 |