|
Name |
alpha-Asarone
|
Molecular Formula | C12H16O3 | |
IUPAC Name* |
1,2,4-trimethoxy-5-[(E)-prop-1-enyl]benzene
|
|
SMILES |
C/C=C/C1=CC(=C(C=C1OC)OC)OC
|
|
InChI |
InChI=1S/C12H16O3/c1-5-6-9-7-11(14-3)12(15-4)8-10(9)13-2/h5-8H,1-4H3/b6-5+
|
|
InChIKey |
RKFAZBXYICVSKP-AATRIKPKSA-N
|
|
Synonyms |
alpha-Asarone; 2883-98-9; Asarone; TRANS-ASARONE; trans-Isoasarone; trans-Isoasaron; Asaron; Asarum camphor; 494-40-6; Etherophenol; Asarabacca camphor; 1,2,4-Trimethoxy-5-(1-propenyl)benzene; 1,2,4-Trimethoxy-5-propenylbenzene; 2,4,5-Trimethoxy-1-propenylbenzene; (E)-Asarone; 1,2,4-trimethoxy-5-[(E)-prop-1-enyl]benzene; Azaron; A-ASARONE; Isoasaron; alpha-Asaron; ZE-Asarone; DQY9PNE5FK; (E)-1,2,4-Trimethoxy-5-prop-1-enylbenzene; Benzene, 1,2,4-trimethoxy-5-propenyl-, (E)-; Benzene, 1,2,4-trimethoxy-5-(1E)-1-propenyl-; 1,2,4-trimethoxy-5-[(1E)-prop-1-en-1-yl]benzene; Benzene, 1,2,4-trimethoxy-5-(1-propenyl)-, (E)-; CHEMBL333306; CHEBI:78309; Benzene, 1,2,4-trimethoxy-5-(1-propenyl)-; (E)-2,4,5-Trimethoxypropenylbenzene; 1,2,4-trimethoxy-5-propenyl-benzene; Benzene, 1,2,4-trimethoxy-5-propenyl-; trans-1,2,4-Trimethoxy-5-(1-propenyl)benzene; benzene, 1,2,4-trimethoxy-5-(1E)-1-propen-1-yl-; (E)-1,2,4-TRIMETHOXY-5-(PROP-1-EN-1-YL)BENZENE; CCRIS 1596; HSDB 3464; (E)-1,2,4-trimethoxy-5-(prop-1-enyl)benzene; UNII-DQY9PNE5FK; EINECS 220-743-6; BRN 1910606; AI3-36725; alpha -Asarone; (E)-1,2,4-Trimethoxy-5-(1-propenyl)benzene; Benzene, 1,2,4-trimethoxy-5-propenyl-, trans-; Isoasaron (6CI); EINECS 207-788-7; NSC 107257; Alpha-Asarone ,(S); alpha-Asarone, 98%; .ALPHA.-ASARONE; ASARONE, ALPHA-; .ALPHA.-ASARON; ASARONE [HSDB]; Trans-(alpha )-asarone; ASARONE [WHO-DD]; Alpha-asarone alpha-asarone; 4-06-00-07476 (Beilstein Handbook Reference); SCHEMBL528746; MEGxp0_001333; ZINC56550; DTXSID00871878; 2,5-Trimethoxy-1-propenylbenzene; alpha-Asarone, analytical standard; HMS3885L22; BCP15389; HY-N0700; BBL028099; BDBM50240783; Benzene,2,4-trimethoxy-5-propenyl-; MFCD00064457; NSC107257; s4772; STL146379; AKOS001590148; trans-2,4,5-Trimethoxypropenylbenzene; CCG-266644; CS-5520; NSC-107257; AC-34898; AS-13278; Benzene,2,4-trimethoxy-5-(1-propenyl)-; 1,2,4-Trimethoxy-5-propenyl-(E)-Benzene; 1,2,4-Trimethoxy-5-propenyl-trans-Benzene; 1,2,4-trimethoxy-5-trans-propenyl-benzene; C17846; N10790; 1,2,4-Trimethoxy-5-(1-propenyl)-(E)-Benzene; 1,2,4-Trimethoxy-5-[(1E)-1-propenyl]benzene; 1,2,4-Trimethoxy-5-(1E)-1-propen-1-ylbenzene; 1,2,4-trimethoxy-5-[(1E)-prop-1-enyl]benzene; 883A989; A819627; Q419658; ASARONE;2,4,5-TRIMETHOXY-1-PROPENYLBENZENE; benzene, 1,2,4-trimethoxy-5-[(1E)-1-propenyl]-; Q-100365; trans-1,2,4-Trimethoxy-5-(1-propenyl)benzene trans-1-Propenyl-2,4,5-trimethoxybenzene; 17-(1,5-Dimethyl-hexyl)-10,13-dimethyl-2,3,4,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol; compound with 1,2,4-trimethoxy-5-propenyl-benzene (Alphaasarone and cholesterol)
|
|
CAS | 2883-98-9 | |
PubChem CID | 636822 | |
ChEMBL ID | CHEMBL333306 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 208.25 | ALogp: | 3.0 |
HBD: | 0 | HBA: | 3 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 27.7 | Aromatic Rings: | 1 |
Heavy Atoms: | 15 | QED Weighted: | 0.757 |
Caco-2 Permeability: | -4.579 | MDCK Permeability: | 0.00001910 |
Pgp-inhibitor: | 0.288 | Pgp-substrate: | 0.985 |
Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.009 |
30% Bioavailability (F30%): | 0.295 |
Blood-Brain-Barrier Penetration (BBB): | 0.787 | Plasma Protein Binding (PPB): | 87.76% |
Volume Distribution (VD): | 1.49 | Fu: | 8.80% |
CYP1A2-inhibitor: | 0.961 | CYP1A2-substrate: | 0.969 |
CYP2C19-inhibitor: | 0.553 | CYP2C19-substrate: | 0.927 |
CYP2C9-inhibitor: | 0.042 | CYP2C9-substrate: | 0.912 |
CYP2D6-inhibitor: | 0.051 | CYP2D6-substrate: | 0.933 |
CYP3A4-inhibitor: | 0.065 | CYP3A4-substrate: | 0.592 |
Clearance (CL): | 9.824 | Half-life (T1/2): | 0.798 |
hERG Blockers: | 0.032 | Human Hepatotoxicity (H-HT): | 0.117 |
Drug-inuced Liver Injury (DILI): | 0.803 | AMES Toxicity: | 0.21 |
Rat Oral Acute Toxicity: | 0.049 | Maximum Recommended Daily Dose: | 0.053 |
Skin Sensitization: | 0.491 | Carcinogencity: | 0.126 |
Eye Corrosion: | 0.376 | Eye Irritation: | 0.889 |
Respiratory Toxicity: | 0.155 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001577 | 1.000 | D0NJ3V | 0.349 | ||||
ENC001461 | 0.510 | D01FFA | 0.337 | ||||
ENC000340 | 0.439 | D0AO5H | 0.320 | ||||
ENC005700 | 0.397 | D0C1SF | 0.309 | ||||
ENC000304 | 0.382 | D09PJX | 0.296 | ||||
ENC001376 | 0.368 | D06GCK | 0.294 | ||||
ENC000501 | 0.365 | D0R0FE | 0.282 | ||||
ENC005938 | 0.364 | D02LZB | 0.275 | ||||
ENC000478 | 0.357 | D0Y7TS | 0.275 | ||||
ENC001379 | 0.356 | D0E6OC | 0.271 |