|
Name |
Urs-12-en-24-oic acid, 3-oxo-, methyl ester
|
Molecular Formula | C31H48O3 | |
IUPAC Name* |
methyl 4,6a,6b,8a,11,12,14b-heptamethyl-3-oxo-1,2,4a,5,6,7,8,9,10,11,12,12a,14,14a-tetradecahydropicene-4-carboxylate
|
|
SMILES |
CC1CCC2(CCC3(C(=CCC4C3(CCC5C4(CCC(=O)C5(C)C(=O)OC)C)C)C2C1C)C)C
|
|
InChI |
InChI=1S/C31H48O3/c1-19-11-14-27(3)17-18-29(5)21(25(27)20(19)2)9-10-22-28(4)15-13-24(32)31(7,26(33)34-8)23(28)12-16-30(22,29)6/h9,19-20,22-23,25H,10-18H2,1-8H3
|
|
InChIKey |
DWWPSRGTSZHWME-UHFFFAOYSA-N
|
|
Synonyms |
Urs-12-en-24-oic acid, 3-oxo-, methyl ester; Methyl 3-oxours-12-en-23-oate #; Urs-12-en-24-oic acid, 3-oxo-, methyl ester, (+)-
|
|
CAS | NA | |
PubChem CID | 612822 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 468.7 | ALogp: | 8.2 |
HBD: | 0 | HBA: | 3 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 43.4 | Aromatic Rings: | 5 |
Heavy Atoms: | 34 | QED Weighted: | 0.228 |
Caco-2 Permeability: | -5.032 | MDCK Permeability: | 0.00001110 |
Pgp-inhibitor: | 0.915 | Pgp-substrate: | 0 |
Human Intestinal Absorption (HIA): | 0.01 | 20% Bioavailability (F20%): | 0.725 |
30% Bioavailability (F30%): | 0.924 |
Blood-Brain-Barrier Penetration (BBB): | 0.768 | Plasma Protein Binding (PPB): | 99.18% |
Volume Distribution (VD): | 1.257 | Fu: | 2.26% |
CYP1A2-inhibitor: | 0.017 | CYP1A2-substrate: | 0.79 |
CYP2C19-inhibitor: | 0.078 | CYP2C19-substrate: | 0.973 |
CYP2C9-inhibitor: | 0.145 | CYP2C9-substrate: | 0.185 |
CYP2D6-inhibitor: | 0.04 | CYP2D6-substrate: | 0.308 |
CYP3A4-inhibitor: | 0.737 | CYP3A4-substrate: | 0.917 |
Clearance (CL): | 18.672 | Half-life (T1/2): | 0.029 |
hERG Blockers: | 0.001 | Human Hepatotoxicity (H-HT): | 0.273 |
Drug-inuced Liver Injury (DILI): | 0.041 | AMES Toxicity: | 0.025 |
Rat Oral Acute Toxicity: | 0.573 | Maximum Recommended Daily Dose: | 0.344 |
Skin Sensitization: | 0.007 | Carcinogencity: | 0.147 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.198 |
Respiratory Toxicity: | 0.967 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005544 | 0.521 | D0P2IT | 0.325 | ||||
ENC005527 | 0.496 | D0I2SD | 0.311 | ||||
ENC001833 | 0.405 | D03MTN | 0.308 | ||||
ENC002033 | 0.395 | D0Q4SD | 0.285 | ||||
ENC004077 | 0.373 | D0EP0C | 0.281 | ||||
ENC003286 | 0.356 | D0Z1XD | 0.275 | ||||
ENC001949 | 0.351 | D04SFH | 0.270 | ||||
ENC003457 | 0.343 | D04GJN | 0.270 | ||||
ENC005963 | 0.329 | D07BSQ | 0.268 | ||||
ENC002012 | 0.324 | D08TEJ | 0.265 |