|
Name |
11-oxoursonic acid benzyl ester
|
Molecular Formula | C37H50O4 | |
IUPAC Name* |
benzyl1,2,6a,6b,9,9,12a-heptamethyl-10,13-dioxo-2,3,4,5,6,6a,7,8,8a,11,12,14b-dodecahydro-1H-picene-4a-carboxylate
|
|
SMILES |
CC1CCC2(C(=O)OCc3ccccc3)CCC3(C)C(=CC(=O)C4C5(C)CCC(=O)C(C)(C)C5CCC43C)C2C1C
|
|
InChI |
InChI=1S/C37H50O4/c1-23-13-18-37(32(40)41-22-25-11-9-8-10-12-25)20-19-35(6)26(30(37)24(23)2)21-27(38)31-34(5)16-15-29(39)33(3,4)28(34)14-17-36(31,35)7/h8-12,21,23-24,28,30-31H,13-20,22H2,1-7H3/t23-,24+,28?,30-,31-,34+,35-,36-,37+/m1/s1
|
|
InChIKey |
PSTOCWRTKWGFIS-SPSMWYAASA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 558.8 | ALogp: | 8.1 |
HBD: | 0 | HBA: | 4 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 60.4 | Aromatic Rings: | 6 |
Heavy Atoms: | 41 | QED Weighted: | 0.333 |
Caco-2 Permeability: | -5.238 | MDCK Permeability: | 0.00001280 |
Pgp-inhibitor: | 0.984 | Pgp-substrate: | 0 |
Human Intestinal Absorption (HIA): | 0.014 | 20% Bioavailability (F20%): | 0.003 |
30% Bioavailability (F30%): | 0.746 |
Blood-Brain-Barrier Penetration (BBB): | 0.592 | Plasma Protein Binding (PPB): | 99.26% |
Volume Distribution (VD): | 1.459 | Fu: | 1.43% |
CYP1A2-inhibitor: | 0.019 | CYP1A2-substrate: | 0.553 |
CYP2C19-inhibitor: | 0.235 | CYP2C19-substrate: | 0.976 |
CYP2C9-inhibitor: | 0.338 | CYP2C9-substrate: | 0.304 |
CYP2D6-inhibitor: | 0.02 | CYP2D6-substrate: | 0.088 |
CYP3A4-inhibitor: | 0.859 | CYP3A4-substrate: | 0.928 |
Clearance (CL): | 15.561 | Half-life (T1/2): | 0.033 |
hERG Blockers: | 0.005 | Human Hepatotoxicity (H-HT): | 0.133 |
Drug-inuced Liver Injury (DILI): | 0.399 | AMES Toxicity: | 0.103 |
Rat Oral Acute Toxicity: | 0.882 | Maximum Recommended Daily Dose: | 0.49 |
Skin Sensitization: | 0.025 | Carcinogencity: | 0.05 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.612 |
Respiratory Toxicity: | 0.956 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001394 | 0.496 | D0TB8C | 0.325 | ||||
ENC002033 | 0.376 | D06CWH | 0.285 | ||||
ENC005544 | 0.349 | D0P2IT | 0.284 | ||||
ENC002118 | 0.335 | D0I2SD | 0.275 | ||||
ENC001745 | 0.335 | D0EP0C | 0.268 | ||||
ENC003130 | 0.320 | D0X4RS | 0.263 | ||||
ENC005398 | 0.315 | D0Q4SD | 0.263 | ||||
ENC003565 | 0.312 | D02CNR | 0.258 | ||||
ENC005403 | 0.306 | D0W5LS | 0.258 | ||||
ENC002746 | 0.303 | D04GJN | 0.257 |