|
Name |
5-(3-Hydroxypropyl)pyrrolidin-2-one
|
Molecular Formula | C7H13NO2 | |
IUPAC Name* |
5-(3-hydroxypropyl)pyrrolidin-2-one
|
|
SMILES |
C1CC(=O)NC1CCCO
|
|
InChI |
InChI=1S/C7H13NO2/c9-5-1-2-6-3-4-7(10)8-6/h6,9H,1-5H2,(H,8,10)
|
|
InChIKey |
CJGLHMSXEHVWKR-UHFFFAOYSA-N
|
|
Synonyms |
5-(3-hydroxypropyl)pyrrolidin-2-one; 80243-73-8; Pyrrolidin-5-one, 2-[3-hydroxypropyl]-; AKOS006354599; 5-(3-Hydroxypropyl)-2-pyrrolidinone #; DA-38695; Pyrrolidine-5-one, 2-[3-hydroxypropyl]-; F2147-7988
|
|
CAS | NA | |
PubChem CID | 558386 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 143.18 | ALogp: | -0.3 |
HBD: | 2 | HBA: | 2 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 49.3 | Aromatic Rings: | 1 |
Heavy Atoms: | 10 | QED Weighted: | 0.602 |
Caco-2 Permeability: | -4.508 | MDCK Permeability: | 0.00023318 |
Pgp-inhibitor: | 0.021 | Pgp-substrate: | 0.032 |
Human Intestinal Absorption (HIA): | 0.044 | 20% Bioavailability (F20%): | 0.013 |
30% Bioavailability (F30%): | 0.183 |
Blood-Brain-Barrier Penetration (BBB): | 0.97 | Plasma Protein Binding (PPB): | 9.13% |
Volume Distribution (VD): | 0.732 | Fu: | 84.39% |
CYP1A2-inhibitor: | 0.026 | CYP1A2-substrate: | 0.239 |
CYP2C19-inhibitor: | 0.028 | CYP2C19-substrate: | 0.186 |
CYP2C9-inhibitor: | 0.012 | CYP2C9-substrate: | 0.323 |
CYP2D6-inhibitor: | 0.004 | CYP2D6-substrate: | 0.136 |
CYP3A4-inhibitor: | 0.009 | CYP3A4-substrate: | 0.212 |
Clearance (CL): | 6.72 | Half-life (T1/2): | 0.801 |
hERG Blockers: | 0.019 | Human Hepatotoxicity (H-HT): | 0.184 |
Drug-inuced Liver Injury (DILI): | 0.063 | AMES Toxicity: | 0.022 |
Rat Oral Acute Toxicity: | 0.017 | Maximum Recommended Daily Dose: | 0.037 |
Skin Sensitization: | 0.525 | Carcinogencity: | 0.179 |
Eye Corrosion: | 0.011 | Eye Irritation: | 0.437 |
Respiratory Toxicity: | 0.042 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005480 | 0.288 | D0YH0N | 0.254 | ||||
ENC000525 | 0.283 | D0EP8X | 0.243 | ||||
ENC003364 | 0.268 | D0P4MT | 0.221 | ||||
ENC000899 | 0.255 | D03CHT | 0.188 | ||||
ENC005481 | 0.255 | D0Z8AA | 0.176 | ||||
ENC005815 | 0.254 | D0CT4D | 0.172 | ||||
ENC000017 | 0.242 | D0Z8SF | 0.170 | ||||
ENC004979 | 0.238 | D0Z9QR | 0.167 | ||||
ENC003976 | 0.225 | D06FDR | 0.167 | ||||
ENC004536 | 0.224 | D0Z4BV | 0.163 |