|
Name |
4-hydroxyphenethyl 5′-oxopyrrolidine-2′-carboxylate
|
Molecular Formula | C13H15NO4 | |
IUPAC Name* |
2-(4-hydroxyphenyl)ethyl5-oxopyrrolidine-2-carboxylate
|
|
SMILES |
O=C1CCC(C(=O)OCCc2ccc(O)cc2)N1
|
|
InChI |
InChI=1S/C13H15NO4/c15-10-3-1-9(2-4-10)7-8-18-13(17)11-5-6-12(16)14-11/h1-4,11,15H,5-8H2,(H,14,16)
|
|
InChIKey |
HWKORUHXNINCAJ-UHFFFAOYSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 249.27 | ALogp: | 0.8 |
HBD: | 2 | HBA: | 4 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 75.6 | Aromatic Rings: | 2 |
Heavy Atoms: | 18 | QED Weighted: | 0.785 |
Caco-2 Permeability: | -4.905 | MDCK Permeability: | 0.00000653 |
Pgp-inhibitor: | 0.005 | Pgp-substrate: | 0.006 |
Human Intestinal Absorption (HIA): | 0.328 | 20% Bioavailability (F20%): | 0.988 |
30% Bioavailability (F30%): | 0.975 |
Blood-Brain-Barrier Penetration (BBB): | 0.075 | Plasma Protein Binding (PPB): | 71.01% |
Volume Distribution (VD): | 2.073 | Fu: | 31.96% |
CYP1A2-inhibitor: | 0.044 | CYP1A2-substrate: | 0.298 |
CYP2C19-inhibitor: | 0.17 | CYP2C19-substrate: | 0.065 |
CYP2C9-inhibitor: | 0.065 | CYP2C9-substrate: | 0.94 |
CYP2D6-inhibitor: | 0.105 | CYP2D6-substrate: | 0.811 |
CYP3A4-inhibitor: | 0.037 | CYP3A4-substrate: | 0.175 |
Clearance (CL): | 6.331 | Half-life (T1/2): | 0.894 |
hERG Blockers: | 0.03 | Human Hepatotoxicity (H-HT): | 0.197 |
Drug-inuced Liver Injury (DILI): | 0.133 | AMES Toxicity: | 0.086 |
Rat Oral Acute Toxicity: | 0.604 | Maximum Recommended Daily Dose: | 0.053 |
Skin Sensitization: | 0.225 | Carcinogencity: | 0.4 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.927 |
Respiratory Toxicity: | 0.276 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001422 | 0.554 | D0S2BV | 0.388 | ||||
ENC005816 | 0.521 | D01CRB | 0.365 | ||||
ENC005812 | 0.508 | D0B3QM | 0.354 | ||||
ENC005811 | 0.508 | D0W1RY | 0.323 | ||||
ENC005814 | 0.438 | D0YH0N | 0.321 | ||||
ENC005813 | 0.438 | D0U5QK | 0.306 | ||||
ENC000870 | 0.426 | D0A6CQ | 0.284 | ||||
ENC005600 | 0.421 | D03ROX | 0.284 | ||||
ENC002602 | 0.421 | D03UOT | 0.281 | ||||
ENC000350 | 0.411 | D02HXS | 0.280 |