|
Name |
Cyclohexane, (2-nitro-2-propenyl)-
|
Molecular Formula | C9H15NO2 | |
IUPAC Name* |
2-nitroprop-2-enylcyclohexane
|
|
SMILES |
C=C(CC1CCCCC1)[N+](=O)[O-]
|
|
InChI |
InChI=1S/C9H15NO2/c1-8(10(11)12)7-9-5-3-2-4-6-9/h9H,1-7H2
|
|
InChIKey |
DXHNHQIKLTZOQX-UHFFFAOYSA-N
|
|
Synonyms |
1-Cyclohexyl-2-nitro-2-propene; (2-Nitro-2-propenyl)cyclohexane #; Cyclohexane, (2-nitro-2-propenyl)-
|
|
CAS | NA | |
PubChem CID | 557866 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 169.22 | ALogp: | 3.7 |
HBD: | 0 | HBA: | 2 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 45.8 | Aromatic Rings: | 1 |
Heavy Atoms: | 12 | QED Weighted: | 0.479 |
Caco-2 Permeability: | -4.457 | MDCK Permeability: | 0.00009530 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0 |
Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.001 |
30% Bioavailability (F30%): | 0.002 |
Blood-Brain-Barrier Penetration (BBB): | 0.929 | Plasma Protein Binding (PPB): | 76.04% |
Volume Distribution (VD): | 0.929 | Fu: | 24.16% |
CYP1A2-inhibitor: | 0.912 | CYP1A2-substrate: | 0.739 |
CYP2C19-inhibitor: | 0.944 | CYP2C19-substrate: | 0.524 |
CYP2C9-inhibitor: | 0.661 | CYP2C9-substrate: | 0.895 |
CYP2D6-inhibitor: | 0.086 | CYP2D6-substrate: | 0.415 |
CYP3A4-inhibitor: | 0.165 | CYP3A4-substrate: | 0.157 |
Clearance (CL): | 5.638 | Half-life (T1/2): | 0.401 |
hERG Blockers: | 0.03 | Human Hepatotoxicity (H-HT): | 0.512 |
Drug-inuced Liver Injury (DILI): | 0.261 | AMES Toxicity: | 0.846 |
Rat Oral Acute Toxicity: | 0.037 | Maximum Recommended Daily Dose: | 0.17 |
Skin Sensitization: | 0.934 | Carcinogencity: | 0.925 |
Eye Corrosion: | 0.768 | Eye Irritation: | 0.978 |
Respiratory Toxicity: | 0.949 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000492 | 0.419 | D03DVJ | 0.391 | ||||
ENC000644 | 0.362 | D04JPJ | 0.293 | ||||
ENC001222 | 0.314 | D04URO | 0.281 | ||||
ENC001169 | 0.304 | D0Y3ME | 0.255 | ||||
ENC000183 | 0.282 | D07GRH | 0.250 | ||||
ENC001306 | 0.269 | D0N4PZ | 0.250 | ||||
ENC000170 | 0.255 | D08MRN | 0.239 | ||||
ENC002200 | 0.242 | D0J0ZS | 0.222 | ||||
ENC002098 | 0.242 | D08VSI | 0.217 | ||||
ENC002181 | 0.234 | D07XJM | 0.215 |