|
Name |
Alanine, N-[N-[N-(3-phenyl-N-propionyl-L-alanyl)-L-valyl]-L-leucyl]-, methyl ester, L-
|
Molecular Formula | C27H42N4O6 | |
IUPAC Name* |
methyl 2-[[4-methyl-2-[[3-methyl-2-[[3-phenyl-2-(propanoylamino)propanoyl]amino]butanoyl]amino]pentanoyl]amino]propanoate
|
|
SMILES |
CCC(=O)NC(CC1=CC=CC=C1)C(=O)NC(C(C)C)C(=O)NC(CC(C)C)C(=O)NC(C)C(=O)OC
|
|
InChI |
InChI=1S/C27H42N4O6/c1-8-22(32)29-21(15-19-12-10-9-11-13-19)25(34)31-23(17(4)5)26(35)30-20(14-16(2)3)24(33)28-18(6)27(36)37-7/h9-13,16-18,20-21,23H,8,14-15H2,1-7H3,(H,28,33)(H,29,32)(H,30,35)(H,31,34)
|
|
InChIKey |
BAIRFIBQXUHMRS-UHFFFAOYSA-N
|
|
Synonyms |
Alanine, N-[N-[N-(3-phenyl-N-propionyl-L-alanyl)-L-valyl]-L-leucyl]-, methyl ester, L-; Methyl 11-benzyl-5-isobutyl-8-isopropyl-2-methyl-4,7,10,13-tetraoxo-3,6,9,12-tetraazapentadecan-1-oate #
|
|
CAS | NA | |
PubChem CID | 551812 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 518.6 | ALogp: | 1.8 |
HBD: | 4 | HBA: | 6 |
Rotatable Bonds: | 15 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 143.0 | Aromatic Rings: | 1 |
Heavy Atoms: | 37 | QED Weighted: | 0.278 |
Caco-2 Permeability: | -5.252 | MDCK Permeability: | 0.00005730 |
Pgp-inhibitor: | 0.997 | Pgp-substrate: | 0.751 |
Human Intestinal Absorption (HIA): | 0.057 | 20% Bioavailability (F20%): | 0.017 |
30% Bioavailability (F30%): | 0.059 |
Blood-Brain-Barrier Penetration (BBB): | 0.118 | Plasma Protein Binding (PPB): | 50.78% |
Volume Distribution (VD): | 0.325 | Fu: | 25.47% |
CYP1A2-inhibitor: | 0.005 | CYP1A2-substrate: | 0.047 |
CYP2C19-inhibitor: | 0.168 | CYP2C19-substrate: | 0.091 |
CYP2C9-inhibitor: | 0.244 | CYP2C9-substrate: | 0.055 |
CYP2D6-inhibitor: | 0.009 | CYP2D6-substrate: | 0.097 |
CYP3A4-inhibitor: | 0.813 | CYP3A4-substrate: | 0.308 |
Clearance (CL): | 4.557 | Half-life (T1/2): | 0.735 |
hERG Blockers: | 0.01 | Human Hepatotoxicity (H-HT): | 0.845 |
Drug-inuced Liver Injury (DILI): | 0.271 | AMES Toxicity: | 0.012 |
Rat Oral Acute Toxicity: | 0.298 | Maximum Recommended Daily Dose: | 0.021 |
Skin Sensitization: | 0.028 | Carcinogencity: | 0.008 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.006 |
Respiratory Toxicity: | 0.011 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001904 | 0.364 | D00UVA | 0.461 | ||||
ENC003576 | 0.328 | D0RA5Q | 0.386 | ||||
ENC002126 | 0.299 | D0O5TQ | 0.383 | ||||
ENC000717 | 0.296 | D0TP2W | 0.365 | ||||
ENC004262 | 0.289 | D00VFE | 0.360 | ||||
ENC003076 | 0.278 | D0SH3I | 0.351 | ||||
ENC000214 | 0.262 | D0ZU9R | 0.333 | ||||
ENC002115 | 0.255 | D08VRX | 0.333 | ||||
ENC000155 | 0.254 | D0G6SE | 0.326 | ||||
ENC005690 | 0.254 | D0X5SJ | 0.313 |