|
Name |
Powellin
|
Molecular Formula | C17H19NO4 | |
IUPAC Name* |
(1S,13R,15R)-9-methoxy-5,7-dioxa-12-azapentacyclo[10.5.2.01,13.02,10.04,8]nonadeca-2,4(8),9,16-tetraen-15-ol
|
|
SMILES |
COC1=C2CN3CC[C@@]4([C@H]3C[C@H](C=C4)O)C2=CC5=C1OCO5
|
|
InChI |
InChI=1S/C17H19NO4/c1-20-15-11-8-18-5-4-17(3-2-10(19)6-14(17)18)12(11)7-13-16(15)22-9-21-13/h2-3,7,10,14,19H,4-6,8-9H2,1H3/t10-,14+,17+/m0/s1
|
|
InChIKey |
VXTCKUJRGBGTEH-NCAQKEMTSA-N
|
|
Synonyms |
Powellin; Powelline; 7363-25-9; 1,2-Didehydro-7-methoxycrinan-3arpha-ol; C12163; (1S,13R,15R)-9-methoxy-5,7-dioxa-12-azapentacyclo[10.5.2.01,13.02,10.04,8]nonadeca-2,4(8),9,16-tetraen-15-ol; AC1L9EYZ; Crinan-3-ol, 1,2-didehydro-7-methoxy-, (3alpha)-; DTXSID60994431; 7-Methoxy-1,2-didehydrocrinan-3-ol
|
|
CAS | 7363-25-9 | |
PubChem CID | 443669 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 301.34 | ALogp: | 1.7 |
HBD: | 1 | HBA: | 5 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 51.2 | Aromatic Rings: | 5 |
Heavy Atoms: | 22 | QED Weighted: | 0.805 |
Caco-2 Permeability: | -4.994 | MDCK Permeability: | 0.00001940 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.826 |
Human Intestinal Absorption (HIA): | 0.003 | 20% Bioavailability (F20%): | 0.016 |
30% Bioavailability (F30%): | 0.048 |
Blood-Brain-Barrier Penetration (BBB): | 0.994 | Plasma Protein Binding (PPB): | 21.18% |
Volume Distribution (VD): | 2.459 | Fu: | 62.38% |
CYP1A2-inhibitor: | 0.537 | CYP1A2-substrate: | 0.872 |
CYP2C19-inhibitor: | 0.475 | CYP2C19-substrate: | 0.853 |
CYP2C9-inhibitor: | 0.054 | CYP2C9-substrate: | 0.735 |
CYP2D6-inhibitor: | 0.853 | CYP2D6-substrate: | 0.713 |
CYP3A4-inhibitor: | 0.881 | CYP3A4-substrate: | 0.801 |
Clearance (CL): | 8.16 | Half-life (T1/2): | 0.543 |
hERG Blockers: | 0.112 | Human Hepatotoxicity (H-HT): | 0.147 |
Drug-inuced Liver Injury (DILI): | 0.043 | AMES Toxicity: | 0.124 |
Rat Oral Acute Toxicity: | 0.722 | Maximum Recommended Daily Dose: | 0.93 |
Skin Sensitization: | 0.068 | Carcinogencity: | 0.728 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.011 |
Respiratory Toxicity: | 0.89 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001059 | 0.617 | D0R9VR | 0.393 | ||||
ENC003230 | 0.425 | D04TDQ | 0.296 | ||||
ENC002961 | 0.316 | D0L1JW | 0.263 | ||||
ENC000702 | 0.302 | D03SKD | 0.252 | ||||
ENC002626 | 0.264 | D03DIG | 0.245 | ||||
ENC000361 | 0.242 | D0T6RC | 0.245 | ||||
ENC000812 | 0.238 | D0D4HN | 0.242 | ||||
ENC001035 | 0.236 | D0M4XY | 0.236 | ||||
ENC005762 | 0.232 | D0W8WB | 0.234 | ||||
ENC005006 | 0.225 | D0X5KF | 0.233 |