|
Name |
Crinamidine
|
Molecular Formula | C17H19NO5 | |
IUPAC Name* |
(1S,13R,15R,16S,18R)-9-methoxy-5,7,17-trioxa-12-azahexacyclo[10.6.2.01,13.02,10.04,8.016,18]icosa-2,4(8),9-trien-15-ol
|
|
SMILES |
COC1=C2CN3CC[C@@]4([C@H]3C[C@H]([C@H]5[C@@H]4O5)O)C2=CC6=C1OCO6
|
|
InChI |
InChI=1S/C17H19NO5/c1-20-13-8-6-18-3-2-17(9(8)4-11-15(13)22-7-21-11)12(18)5-10(19)14-16(17)23-14/h4,10,12,14,16,19H,2-3,5-7H2,1H3/t10-,12-,14+,16+,17+/m1/s1
|
|
InChIKey |
HHEOZJCKMANJQV-CUQLUGJVSA-N
|
|
Synonyms |
crinamidine; NSC709877; NSC-709877; C12168; CHEBI:31436; Q27114310; (1S,13R,15R,16S,18R)-9-methoxy-5,7,17-trioxa-12-azahexacyclo[10.6.2.01,13.02,10.04,8.016,18]icosa-2,4(8),9-trien-15-ol; 6793-66-4
|
|
CAS | NA | |
PubChem CID | 399204 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 317.34 | ALogp: | 0.8 |
HBD: | 1 | HBA: | 6 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 63.7 | Aromatic Rings: | 6 |
Heavy Atoms: | 23 | QED Weighted: | 0.785 |
Caco-2 Permeability: | -5.353 | MDCK Permeability: | 0.00002340 |
Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.965 |
Human Intestinal Absorption (HIA): | 0.003 | 20% Bioavailability (F20%): | 0.007 |
30% Bioavailability (F30%): | 0.523 |
Blood-Brain-Barrier Penetration (BBB): | 0.992 | Plasma Protein Binding (PPB): | 22.47% |
Volume Distribution (VD): | 2.275 | Fu: | 63.31% |
CYP1A2-inhibitor: | 0.173 | CYP1A2-substrate: | 0.879 |
CYP2C19-inhibitor: | 0.086 | CYP2C19-substrate: | 0.848 |
CYP2C9-inhibitor: | 0.017 | CYP2C9-substrate: | 0.617 |
CYP2D6-inhibitor: | 0.758 | CYP2D6-substrate: | 0.697 |
CYP3A4-inhibitor: | 0.677 | CYP3A4-substrate: | 0.702 |
Clearance (CL): | 13.086 | Half-life (T1/2): | 0.608 |
hERG Blockers: | 0.227 | Human Hepatotoxicity (H-HT): | 0.748 |
Drug-inuced Liver Injury (DILI): | 0.054 | AMES Toxicity: | 0.113 |
Rat Oral Acute Toxicity: | 0.73 | Maximum Recommended Daily Dose: | 0.891 |
Skin Sensitization: | 0.087 | Carcinogencity: | 0.778 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.011 |
Respiratory Toxicity: | 0.941 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001089 | 0.617 | D0T6RC | 0.300 | ||||
ENC002961 | 0.307 | D04TDQ | 0.277 | ||||
ENC000702 | 0.293 | D03DIG | 0.262 | ||||
ENC003230 | 0.283 | D0X5KF | 0.250 | ||||
ENC000361 | 0.246 | D0D4HN | 0.246 | ||||
ENC002626 | 0.245 | D0L1JW | 0.246 | ||||
ENC003767 | 0.224 | D0R9VR | 0.245 | ||||
ENC004130 | 0.222 | D03SKD | 0.234 | ||||
ENC000812 | 0.216 | D04JHN | 0.233 | ||||
ENC002159 | 0.216 | D0WE3O | 0.233 |