|
Name |
(-)-Limonene
|
Molecular Formula | C10H16 | |
IUPAC Name* |
(4S)-1-methyl-4-prop-1-en-2-ylcyclohexene
|
|
SMILES |
CC1=CC[C@H](CC1)C(=C)C
|
|
InChI |
InChI=1S/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h4,10H,1,5-7H2,2-3H3/t10-/m1/s1
|
|
InChIKey |
XMGQYMWWDOXHJM-SNVBAGLBSA-N
|
|
Synonyms |
(-)-Limonene; 5989-54-8; l-Limonene; (S)-Limonene; (S)-(-)-Limonene; (S)-1-Methyl-4-(prop-1-en-2-yl)cyclohex-1-ene; (4S)-limonene; S-(-)-Limonene; (-)-(4S)-Limonene; (S)-p-Mentha-1,8-diene; (-)-(S)-Limonene; (S)-(?)-Limonene; (4S)-1-methyl-4-(prop-1-en-2-yl)cyclohex-1-ene; Cyclohexene, 1-methyl-4-(1-methylethenyl)-, (4S)-; Limonene, L-; (-)-p-Mentha-1,8-diene; P-Mentha-1,8-diene, (S)-(-)-; Limonene, (-)-; (4S)-1-methyl-4-prop-1-en-2-ylcyclohexene; 47MAJ1Y2NE; CHEBI:15383; Cyclohexene, 1-methyl-4-(1-methylethenyl)-, (S)-; beta-Limonene; UNII-47MAJ1Y2NE; laevo-limonene; L-Limonen; EINECS 227-815-6; MFCD00001558; AI3-25390; EC 227-815-6; DSSTox_CID_27078; DSSTox_RID_82091; 1-Methyl-4-(1-methylethenyl)cyclohexene, (S)-; DSSTox_GSID_47078; 4alphaH-p-mentha-1,8-diene; (-)-LIMONENE [FCC]; CHEMBL236688; DTXSID6047078; (S)-(-)-Limonene, 96%; ZINC968226; (S)-(-)-p-mentha-1,8-diene; HY-Z0478; Tox21_302295; s6055; AKOS016844135; LMPR0102090002; (4S)-4-isopropenyl-1-methylcyclohexene; (S)-(-)-Limonene, analytical standard; ( inverted exclamation markA)-LIMONENE; (S)-(-)-Limonene, >=95%, FG; 4-Isopropenyl-1-methyl-1-cyclohexene #; NCGC00256073-01; AS-75559; CAS-5989-54-8; (4S)-1-methyl-4-isopropenylcyclohex-1-ene; CS-0014283; L0132; (S)-1-methyl-4-(1-methylethenyl)cyclohexene; C00521; EN300-196159; F20308; (4S)-1-Methyl-4-(prop-1-en-2-yl)cyclohexene; (4S)-1-methyl-4-(1-methyl ethenyl) cyclohexene; (S)-(-)-1-methyl-4-(1-methylethenyl)cyclohexene; W-110076; Q27089405; Z1255430958; (S)-(-)-Limonene, purum, >=95.0% (sum of enantiomers, GC); 9IU
|
|
CAS | 5989-54-8 | |
PubChem CID | 439250 | |
ChEMBL ID | CHEMBL236688 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 136.23 | ALogp: | 3.4 |
HBD: | 0 | HBA: | 0 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 0.0 | Aromatic Rings: | 1 |
Heavy Atoms: | 10 | QED Weighted: | 0.477 |
Caco-2 Permeability: | -4.371 | MDCK Permeability: | 0.00001890 |
Pgp-inhibitor: | 0.007 | Pgp-substrate: | 0.003 |
Human Intestinal Absorption (HIA): | 0.003 | 20% Bioavailability (F20%): | 0.94 |
30% Bioavailability (F30%): | 0.831 |
Blood-Brain-Barrier Penetration (BBB): | 0.974 | Plasma Protein Binding (PPB): | 75.11% |
Volume Distribution (VD): | 3.533 | Fu: | 19.97% |
CYP1A2-inhibitor: | 0.703 | CYP1A2-substrate: | 0.564 |
CYP2C19-inhibitor: | 0.252 | CYP2C19-substrate: | 0.775 |
CYP2C9-inhibitor: | 0.055 | CYP2C9-substrate: | 0.774 |
CYP2D6-inhibitor: | 0.02 | CYP2D6-substrate: | 0.851 |
CYP3A4-inhibitor: | 0.06 | CYP3A4-substrate: | 0.252 |
Clearance (CL): | 13.285 | Half-life (T1/2): | 0.27 |
hERG Blockers: | 0.028 | Human Hepatotoxicity (H-HT): | 0.738 |
Drug-inuced Liver Injury (DILI): | 0.057 | AMES Toxicity: | 0.015 |
Rat Oral Acute Toxicity: | 0.022 | Maximum Recommended Daily Dose: | 0.785 |
Skin Sensitization: | 0.846 | Carcinogencity: | 0.924 |
Eye Corrosion: | 0.944 | Eye Irritation: | 0.981 |
Respiratory Toxicity: | 0.448 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000555 | 1.000 | D0O1UZ | 0.233 | ||||
ENC000369 | 0.583 | D0A2AJ | 0.185 | ||||
ENC002276 | 0.550 | D03KEK | 0.182 | ||||
ENC001981 | 0.545 | D0Z8SF | 0.174 | ||||
ENC002219 | 0.543 | D0WO8W | 0.167 | ||||
ENC002339 | 0.511 | D0B4RU | 0.167 | ||||
ENC001641 | 0.478 | D0H1QY | 0.167 | ||||
ENC003255 | 0.478 | D0K0EK | 0.162 | ||||
ENC000194 | 0.474 | D04GJN | 0.159 | ||||
ENC003150 | 0.473 | D0RA9E | 0.158 |