|
Name |
[2,3,4,5-Tetraacetyloxy-6,6-bis(ethylsulfanyl)hexyl] acetate
|
Molecular Formula | C20H32O10S2 | |
IUPAC Name* |
[2,3,4,5-tetraacetyloxy-6,6-bis(ethylsulfanyl)hexyl] acetate
|
|
SMILES |
CCSC(C(C(C(C(COC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C)SCC
|
|
InChI |
InChI=1S/C20H32O10S2/c1-8-31-20(32-9-2)19(30-15(7)25)18(29-14(6)24)17(28-13(5)23)16(27-12(4)22)10-26-11(3)21/h16-20H,8-10H2,1-7H3
|
|
InChIKey |
NFCGRENOZDIGBW-UHFFFAOYSA-N
|
|
Synonyms |
4984-72-9; [2,3,4,5-tetraacetyloxy-6,6-bis(ethylsulfanyl)hexyl] acetate; D-Galactose, pentaacetate; D-Galactose, diethyl mercaptal, pentaacetate; Galactose, pentaacetate, D-; DTXSID90280172; NSC15734; NSC46399; NSC-15734; NSC-46399; Galactose, diethyl mercaptal, pentaacetate, D-
|
|
CAS | 6935-10-0 | |
PubChem CID | 225891 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 496.6 | ALogp: | 2.1 |
HBD: | 0 | HBA: | 12 |
Rotatable Bonds: | 19 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 182.0 | Aromatic Rings: | 0 |
Heavy Atoms: | 32 | QED Weighted: | 0.199 |
Caco-2 Permeability: | -5.123 | MDCK Permeability: | 0.00006190 |
Pgp-inhibitor: | 0.95 | Pgp-substrate: | 0.036 |
Human Intestinal Absorption (HIA): | 0.997 | 20% Bioavailability (F20%): | 0.04 |
30% Bioavailability (F30%): | 0.99 |
Blood-Brain-Barrier Penetration (BBB): | 0.241 | Plasma Protein Binding (PPB): | 42.55% |
Volume Distribution (VD): | 1.269 | Fu: | 50.71% |
CYP1A2-inhibitor: | 0.066 | CYP1A2-substrate: | 0.015 |
CYP2C19-inhibitor: | 0.01 | CYP2C19-substrate: | 0.059 |
CYP2C9-inhibitor: | 0 | CYP2C9-substrate: | 0.018 |
CYP2D6-inhibitor: | 0.99 | CYP2D6-substrate: | 0.082 |
CYP3A4-inhibitor: | 0.07 | CYP3A4-substrate: | 0.19 |
Clearance (CL): | 2.515 | Half-life (T1/2): | 0.852 |
hERG Blockers: | 0.002 | Human Hepatotoxicity (H-HT): | 0.955 |
Drug-inuced Liver Injury (DILI): | 0.984 | AMES Toxicity: | 0.027 |
Rat Oral Acute Toxicity: | 0.072 | Maximum Recommended Daily Dose: | 0.008 |
Skin Sensitization: | 0.238 | Carcinogencity: | 0.046 |
Eye Corrosion: | 0.007 | Eye Irritation: | 0.099 |
Respiratory Toxicity: | 0.005 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001014 | 0.286 | D0Q6DX | 0.323 | ||||
ENC005669 | 0.240 | D0L2UN | 0.297 | ||||
ENC001223 | 0.223 | D0OL7F | 0.203 | ||||
ENC005933 | 0.213 | D09SIK | 0.203 | ||||
ENC000144 | 0.212 | D0K2TB | 0.203 | ||||
ENC001266 | 0.212 | D0K3LW | 0.196 | ||||
ENC003073 | 0.212 | D0R3FP | 0.190 | ||||
ENC001032 | 0.209 | D0X4FM | 0.178 | ||||
ENC005876 | 0.208 | D0VT8P | 0.175 | ||||
ENC005592 | 0.207 | D00MLW | 0.167 |