|
Name |
6,10-Dimethylundecan-2-one
|
Molecular Formula | C13H26O | |
IUPAC Name* |
6,10-dimethylundecan-2-one
|
|
SMILES |
CC(C)CCCC(C)CCCC(=O)C
|
|
InChI |
InChI=1S/C13H26O/c1-11(2)7-5-8-12(3)9-6-10-13(4)14/h11-12H,5-10H2,1-4H3
|
|
InChIKey |
RBGLEUBCAJNCTR-UHFFFAOYSA-N
|
|
Synonyms |
6,10-Dimethylundecan-2-one; Hexahydropseudoionone; 2-Undecanone, 6,10-dimethyl-; 6,10-Dimethyl-2-undecanone; 1604-34-8; Tetrahydrogeranylacetone; Pseudoionone, hexahydro-; NSC-15338; 91TGG00357; UNII-91TGG00357; NSC15338; EINECS 216-509-8; EINECS 262-082-6; NSC 15338; AI3-15989; 2-Undecanone,10-dimethyl-; 60148-93-8; SCHEMBL117939; 6,10-dimethylundecane-2-one; DTXSID80862709; (1)-6,10-Dimethylundecan-2-one; STL562193; 2,6-DIMETHYLUNDECANE-10-ONE; AKOS006281602; CS-0263271; E85200; EN300-8588865; Q27271425
|
|
CAS | 1604-34-8 | |
PubChem CID | 95495 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 198.34 | ALogp: | 4.5 |
HBD: | 0 | HBA: | 1 |
Rotatable Bonds: | 8 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 17.1 | Aromatic Rings: | 0 |
Heavy Atoms: | 14 | QED Weighted: | 0.548 |
Caco-2 Permeability: | -4.38 | MDCK Permeability: | 0.00001560 |
Pgp-inhibitor: | 0.032 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.003 | 20% Bioavailability (F20%): | 0.958 |
30% Bioavailability (F30%): | 0.954 |
Blood-Brain-Barrier Penetration (BBB): | 0.903 | Plasma Protein Binding (PPB): | 96.04% |
Volume Distribution (VD): | 1.21 | Fu: | 2.98% |
CYP1A2-inhibitor: | 0.716 | CYP1A2-substrate: | 0.563 |
CYP2C19-inhibitor: | 0.464 | CYP2C19-substrate: | 0.82 |
CYP2C9-inhibitor: | 0.606 | CYP2C9-substrate: | 0.954 |
CYP2D6-inhibitor: | 0.023 | CYP2D6-substrate: | 0.155 |
CYP3A4-inhibitor: | 0.053 | CYP3A4-substrate: | 0.169 |
Clearance (CL): | 7.597 | Half-life (T1/2): | 0.413 |
hERG Blockers: | 0.025 | Human Hepatotoxicity (H-HT): | 0.048 |
Drug-inuced Liver Injury (DILI): | 0.15 | AMES Toxicity: | 0.004 |
Rat Oral Acute Toxicity: | 0.017 | Maximum Recommended Daily Dose: | 0.021 |
Skin Sensitization: | 0.69 | Carcinogencity: | 0.056 |
Eye Corrosion: | 0.985 | Eye Irritation: | 0.97 |
Respiratory Toxicity: | 0.094 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001798 | 0.667 | D00FSV | 0.333 | ||||
ENC001286 | 0.571 | D03LGY | 0.250 | ||||
ENC000622 | 0.571 | D00WUF | 0.250 | ||||
ENC000536 | 0.571 | D0UU9Y | 0.244 | ||||
ENC000902 | 0.538 | D0Y3KG | 0.235 | ||||
ENC000537 | 0.538 | D09QEI | 0.230 | ||||
ENC000503 | 0.537 | D0ZI4H | 0.221 | ||||
ENC000581 | 0.535 | D0FD0H | 0.220 | ||||
ENC000354 | 0.517 | D0D9NY | 0.220 | ||||
ENC001722 | 0.516 | D0ZK8H | 0.213 |