![]() |
Name |
Alternate B
|
Molecular Formula | C14H14O7 | |
IUPAC Name* |
methyl2-(8-hydroxy-6-methoxy-3-methyl-1,4-dioxoisochromen-3-yl)acetate
|
|
SMILES |
COC(=O)CC1(C)OC(=O)c2c(O)cc(OC)cc2C1=O
|
|
InChI |
InChI=1S/C14H14O7/c1-14(6-10(16)20-3)12(17)8-4-7(19-2)5-9(15)11(8)13(18)21-14/h4-5,15H,6H2,1-3H3
|
|
InChIKey |
BSHDGCXWOZFMRM-UHFFFAOYSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 294.26 | ALogp: | 1.1 |
HBD: | 1 | HBA: | 7 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 99.1 | Aromatic Rings: | 2 |
Heavy Atoms: | 21 | QED Weighted: | 0.844 |
Caco-2 Permeability: | -4.77 | MDCK Permeability: | 0.00003510 |
Pgp-inhibitor: | 0.017 | Pgp-substrate: | 0 |
Human Intestinal Absorption (HIA): | 0.179 | 20% Bioavailability (F20%): | 0.055 |
30% Bioavailability (F30%): | 0.981 |
Blood-Brain-Barrier Penetration (BBB): | 0.755 | Plasma Protein Binding (PPB): | 57.47% |
Volume Distribution (VD): | 0.789 | Fu: | 31.86% |
CYP1A2-inhibitor: | 0.873 | CYP1A2-substrate: | 0.812 |
CYP2C19-inhibitor: | 0.283 | CYP2C19-substrate: | 0.463 |
CYP2C9-inhibitor: | 0.229 | CYP2C9-substrate: | 0.697 |
CYP2D6-inhibitor: | 0.123 | CYP2D6-substrate: | 0.309 |
CYP3A4-inhibitor: | 0.68 | CYP3A4-substrate: | 0.264 |
Clearance (CL): | 10.078 | Half-life (T1/2): | 0.817 |
hERG Blockers: | 0.01 | Human Hepatotoxicity (H-HT): | 0.078 |
Drug-inuced Liver Injury (DILI): | 0.792 | AMES Toxicity: | 0.034 |
Rat Oral Acute Toxicity: | 0.015 | Maximum Recommended Daily Dose: | 0.06 |
Skin Sensitization: | 0.066 | Carcinogencity: | 0.018 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.136 |
Respiratory Toxicity: | 0.095 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004059 | ![]() |
0.579 | D0C1SF | ![]() |
0.274 | ||
ENC004824 | ![]() |
0.548 | D06GCK | ![]() |
0.238 | ||
ENC003954 | ![]() |
0.548 | D02XJY | ![]() |
0.235 | ||
ENC003953 | ![]() |
0.548 | D07MGA | ![]() |
0.232 | ||
ENC002837 | ![]() |
0.513 | D0N1FS | ![]() |
0.229 | ||
ENC005309 | ![]() |
0.507 | D00WVW | ![]() |
0.228 | ||
ENC003686 | ![]() |
0.494 | D0B9EJ | ![]() |
0.228 | ||
ENC003610 | ![]() |
0.494 | D0DJ1B | ![]() |
0.226 | ||
ENC003974 | ![]() |
0.494 | D0B0AX | ![]() |
0.225 | ||
ENC003769 | ![]() |
0.494 | D09DHY | ![]() |
0.225 |