![]() |
Name |
terrtryptop A
|
Molecular Formula | C16H19N3O2 | |
IUPAC Name* |
2-hydroxyimino-3-[7-(3-methylbut-2-enyl)-1H-indol-3-yl]propanamide
|
|
SMILES |
CC(C)=CCc1cccc2c(CC(=NO)C(N)=O)c[nH]c12
|
|
InChI |
InChI=1S/C16H19N3O2/c1-10(2)6-7-11-4-3-5-13-12(9-18-15(11)13)8-14(19-21)16(17)20/h3-6,9,18,21H,7-8H2,1-2H3,(H2,17,20)/b19-14+
|
|
InChIKey |
WIABFPOGRRFJPJ-XMHGGMMESA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 285.35 | ALogp: | 2.5 |
HBD: | 3 | HBA: | 3 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 91.5 | Aromatic Rings: | 2 |
Heavy Atoms: | 21 | QED Weighted: | 0.34 |
Caco-2 Permeability: | -4.825 | MDCK Permeability: | 0.00000826 |
Pgp-inhibitor: | 0.014 | Pgp-substrate: | 0.145 |
Human Intestinal Absorption (HIA): | 0.008 | 20% Bioavailability (F20%): | 0.924 |
30% Bioavailability (F30%): | 0.304 |
Blood-Brain-Barrier Penetration (BBB): | 0.961 | Plasma Protein Binding (PPB): | 97.82% |
Volume Distribution (VD): | 0.879 | Fu: | 2.05% |
CYP1A2-inhibitor: | 0.914 | CYP1A2-substrate: | 0.168 |
CYP2C19-inhibitor: | 0.926 | CYP2C19-substrate: | 0.059 |
CYP2C9-inhibitor: | 0.707 | CYP2C9-substrate: | 0.877 |
CYP2D6-inhibitor: | 0.722 | CYP2D6-substrate: | 0.674 |
CYP3A4-inhibitor: | 0.428 | CYP3A4-substrate: | 0.171 |
Clearance (CL): | 5.902 | Half-life (T1/2): | 0.419 |
hERG Blockers: | 0.056 | Human Hepatotoxicity (H-HT): | 0.876 |
Drug-inuced Liver Injury (DILI): | 0.945 | AMES Toxicity: | 0.461 |
Rat Oral Acute Toxicity: | 0.79 | Maximum Recommended Daily Dose: | 0.598 |
Skin Sensitization: | 0.171 | Carcinogencity: | 0.13 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.031 |
Respiratory Toxicity: | 0.264 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001987 | ![]() |
0.488 | D05EJG | ![]() |
0.299 | ||
ENC001366 | ![]() |
0.420 | D0AN7B | ![]() |
0.293 | ||
ENC002096 | ![]() |
0.377 | D0N1WU | ![]() |
0.272 | ||
ENC003357 | ![]() |
0.375 | D02IHW | ![]() |
0.247 | ||
ENC004349 | ![]() |
0.365 | D0U1OM | ![]() |
0.242 | ||
ENC001090 | ![]() |
0.361 | D0WD8M | ![]() |
0.238 | ||
ENC004987 | ![]() |
0.361 | D00XWD | ![]() |
0.235 | ||
ENC003358 | ![]() |
0.346 | D0O2YE | ![]() |
0.235 | ||
ENC000043 | ![]() |
0.338 | D0Z6UC | ![]() |
0.228 | ||
ENC004988 | ![]() |
0.333 | D0BV3J | ![]() |
0.227 |