![]() |
Name |
aurovertin U
|
Molecular Formula | C23H30O7 | |
IUPAC Name* |
6-[6-(4,8-dihydroxy-1,3,5,7-tetramethyl-2,6-dioxabicyclo[3.2.1]octan-3-yl)hexa-1,3,5-trienyl]-4-methoxy-5-methylpyran-2-one
|
|
SMILES |
COc1cc(=O)oc(C=CC=CC=CC2(C)OC3(C)C(C)OC(C)(C2O)C3O)c1C
|
|
InChI |
InChI=1S/C23H30O7/c1-14-16(28-18(24)13-17(14)27-6)11-9-7-8-10-12-21(3)19(25)23(5)20(26)22(4,30-21)15(2)29-23/h7-13,15,19-20,25-26H,1-6H3/b8-7+,11-9+,12-10+/t15-,19+,20?,21+,22-,23+/m1/s1
|
|
InChIKey |
BHMIDMOHWXULQB-QYKKEGJWSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 418.49 | ALogp: | 2.5 |
HBD: | 2 | HBA: | 7 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 98.4 | Aromatic Rings: | 3 |
Heavy Atoms: | 30 | QED Weighted: | 0.708 |
Caco-2 Permeability: | -4.917 | MDCK Permeability: | 0.00001510 |
Pgp-inhibitor: | 0.99 | Pgp-substrate: | 0.89 |
Human Intestinal Absorption (HIA): | 0.077 | 20% Bioavailability (F20%): | 0.152 |
30% Bioavailability (F30%): | 0.994 |
Blood-Brain-Barrier Penetration (BBB): | 0.235 | Plasma Protein Binding (PPB): | 82.05% |
Volume Distribution (VD): | 2.272 | Fu: | 8.90% |
CYP1A2-inhibitor: | 0.021 | CYP1A2-substrate: | 0.864 |
CYP2C19-inhibitor: | 0.024 | CYP2C19-substrate: | 0.842 |
CYP2C9-inhibitor: | 0.029 | CYP2C9-substrate: | 0.075 |
CYP2D6-inhibitor: | 0.017 | CYP2D6-substrate: | 0.677 |
CYP3A4-inhibitor: | 0.458 | CYP3A4-substrate: | 0.376 |
Clearance (CL): | 9.906 | Half-life (T1/2): | 0.596 |
hERG Blockers: | 0.842 | Human Hepatotoxicity (H-HT): | 0.984 |
Drug-inuced Liver Injury (DILI): | 0.868 | AMES Toxicity: | 0.449 |
Rat Oral Acute Toxicity: | 0.981 | Maximum Recommended Daily Dose: | 0.925 |
Skin Sensitization: | 0.463 | Carcinogencity: | 0.966 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.006 |
Respiratory Toxicity: | 0.967 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003144 | ![]() |
0.705 | D05QDC | ![]() |
0.261 | ||
ENC005764 | ![]() |
0.583 | D0B1IP | ![]() |
0.238 | ||
ENC005765 | ![]() |
0.583 | D0FG6M | ![]() |
0.211 | ||
ENC001850 | ![]() |
0.538 | D0W2EK | ![]() |
0.207 | ||
ENC005399 | ![]() |
0.450 | D0E9KA | ![]() |
0.199 | ||
ENC005400 | ![]() |
0.433 | D0Q0PR | ![]() |
0.198 | ||
ENC003443 | ![]() |
0.395 | D02JNM | ![]() |
0.181 | ||
ENC005401 | ![]() |
0.351 | D06TQZ | ![]() |
0.180 | ||
ENC001413 | ![]() |
0.269 | D0Y2YP | ![]() |
0.179 | ||
ENC005632 | ![]() |
0.260 | D02DGU | ![]() |
0.176 |