![]() |
Name |
novae-zelandin A
|
Molecular Formula | C11H14O3 | |
IUPAC Name* |
5-but-2-enyl-4-methoxy-6-methylpyran-2-one
|
|
SMILES |
CC=CCc1c(OC)cc(=O)oc1C
|
|
InChI |
InChI=1S/C11H14O3/c1-4-5-6-9-8(2)14-11(12)7-10(9)13-3/h4-5,7H,6H2,1-3H3/b5-4+
|
|
InChIKey |
VAYLEZJOSRUKOK-SNAWJCMRSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 194.23 | ALogp: | 2.1 |
HBD: | 0 | HBA: | 3 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 39.4 | Aromatic Rings: | 1 |
Heavy Atoms: | 14 | QED Weighted: | 0.694 |
Caco-2 Permeability: | -4.57 | MDCK Permeability: | 0.00002350 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.015 |
Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.003 |
30% Bioavailability (F30%): | 0.979 |
Blood-Brain-Barrier Penetration (BBB): | 0.206 | Plasma Protein Binding (PPB): | 67.45% |
Volume Distribution (VD): | 1.069 | Fu: | 23.98% |
CYP1A2-inhibitor: | 0.875 | CYP1A2-substrate: | 0.959 |
CYP2C19-inhibitor: | 0.669 | CYP2C19-substrate: | 0.653 |
CYP2C9-inhibitor: | 0.063 | CYP2C9-substrate: | 0.875 |
CYP2D6-inhibitor: | 0.033 | CYP2D6-substrate: | 0.858 |
CYP3A4-inhibitor: | 0.069 | CYP3A4-substrate: | 0.269 |
Clearance (CL): | 12.424 | Half-life (T1/2): | 0.779 |
hERG Blockers: | 0.032 | Human Hepatotoxicity (H-HT): | 0.27 |
Drug-inuced Liver Injury (DILI): | 0.26 | AMES Toxicity: | 0.035 |
Rat Oral Acute Toxicity: | 0.033 | Maximum Recommended Daily Dose: | 0.043 |
Skin Sensitization: | 0.209 | Carcinogencity: | 0.783 |
Eye Corrosion: | 0.415 | Eye Irritation: | 0.802 |
Respiratory Toxicity: | 0.16 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003262 | ![]() |
0.583 | D0E9CD | ![]() |
0.236 | ||
ENC001776 | ![]() |
0.560 | D0FA2O | ![]() |
0.232 | ||
ENC003263 | ![]() |
0.560 | D0G4KG | ![]() |
0.230 | ||
ENC005955 | ![]() |
0.560 | D03LGG | ![]() |
0.222 | ||
ENC005954 | ![]() |
0.472 | D0U5CE | ![]() |
0.222 | ||
ENC001413 | ![]() |
0.442 | D08SKH | ![]() |
0.217 | ||
ENC005956 | ![]() |
0.431 | D05QDC | ![]() |
0.214 | ||
ENC006029 | ![]() |
0.431 | D0B1IP | ![]() |
0.213 | ||
ENC001982 | ![]() |
0.418 | D08VYV | ![]() |
0.211 | ||
ENC003971 | ![]() |
0.418 | D0S5CH | ![]() |
0.203 |