![]() |
Name |
4-Hydroxy-3-(3-methylbut-3-en-1-yn-1-yl)benzoic acid
|
Molecular Formula | C12H10O3 | |
IUPAC Name* |
4-hydroxy-3-(3-methylbut-3-en-1-ynyl)benzoicacid
|
|
SMILES |
C=C(C)C#Cc1cc(C(=O)O)ccc1O
|
|
InChI |
InChI=1S/C12H10O3/c1-8(2)3-4-9-7-10(12(14)15)5-6-11(9)13/h5-7,13H,1H2,2H3,(H,14,15)
|
|
InChIKey |
HFSFSKBQIGXUEY-UHFFFAOYSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 202.21 | ALogp: | 2.0 |
HBD: | 2 | HBA: | 2 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 57.5 | Aromatic Rings: | 1 |
Heavy Atoms: | 15 | QED Weighted: | 0.688 |
Caco-2 Permeability: | -5.065 | MDCK Permeability: | 0.00001520 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0 |
Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.006 |
30% Bioavailability (F30%): | 0.004 |
Blood-Brain-Barrier Penetration (BBB): | 0.16 | Plasma Protein Binding (PPB): | 78.73% |
Volume Distribution (VD): | 0.351 | Fu: | 7.92% |
CYP1A2-inhibitor: | 0.154 | CYP1A2-substrate: | 0.131 |
CYP2C19-inhibitor: | 0.133 | CYP2C19-substrate: | 0.055 |
CYP2C9-inhibitor: | 0.427 | CYP2C9-substrate: | 0.192 |
CYP2D6-inhibitor: | 0.033 | CYP2D6-substrate: | 0.114 |
CYP3A4-inhibitor: | 0.082 | CYP3A4-substrate: | 0.102 |
Clearance (CL): | 2.574 | Half-life (T1/2): | 0.883 |
hERG Blockers: | 0.008 | Human Hepatotoxicity (H-HT): | 0.526 |
Drug-inuced Liver Injury (DILI): | 0.956 | AMES Toxicity: | 0.085 |
Rat Oral Acute Toxicity: | 0.459 | Maximum Recommended Daily Dose: | 0.156 |
Skin Sensitization: | 0.896 | Carcinogencity: | 0.757 |
Eye Corrosion: | 0.653 | Eye Irritation: | 0.987 |
Respiratory Toxicity: | 0.969 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000986 | ![]() |
0.667 | D0C4YC | ![]() |
0.380 | ||
ENC004655 | ![]() |
0.625 | D01WJL | ![]() |
0.353 | ||
ENC005712 | ![]() |
0.596 | D0BA6T | ![]() |
0.317 | ||
ENC004146 | ![]() |
0.519 | D0V9EN | ![]() |
0.316 | ||
ENC000002 | ![]() |
0.500 | D07HBX | ![]() |
0.314 | ||
ENC000296 | ![]() |
0.500 | D08HVR | ![]() |
0.305 | ||
ENC004987 | ![]() |
0.481 | D0P7JZ | ![]() |
0.302 | ||
ENC001090 | ![]() |
0.481 | D0I3RO | ![]() |
0.295 | ||
ENC002688 | ![]() |
0.429 | D0U0OT | ![]() |
0.290 | ||
ENC004656 | ![]() |
0.421 | D0S2BT | ![]() |
0.273 |