![]() |
Name |
Sclerazaphilone E
|
Molecular Formula | C29H42ClNO6 | |
IUPAC Name* |
methyl2-[5-(2-acetyloxy-4-chloro-2-methyl-3-oxobutanoyl)-2-(3,5,5-trimethylhepta-1,3-dienyl)-4H-pyridin-1-yl]-4-methylpentanoate
|
|
SMILES |
CCC(C)(C)C=C(C)C=CC1=CCC(C(=O)C(C)(OC(C)=O)C(=O)CCl)=CN1C(CC(C)C)C(=O)OC
|
|
InChI |
InChI=1S/C29H42ClNO6/c1-10-28(6,7)16-20(4)11-13-23-14-12-22(18-31(23)24(15-19(2)3)27(35)36-9)26(34)29(8,25(33)17-30)37-21(5)32/h11,13-14,16,18-19,24H,10,12,15,17H2,1-9H3/b13-11+,20-16+/t24-,29?/m0/s1
|
|
InChIKey |
YOUHAXZROBMQGI-UAPMGQBXSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 536.11 | ALogp: | 5.7 |
HBD: | 0 | HBA: | 7 |
Rotatable Bonds: | 13 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 90.0 | Aromatic Rings: | 1 |
Heavy Atoms: | 37 | QED Weighted: | 0.127 |
Caco-2 Permeability: | -4.791 | MDCK Permeability: | 0.00002710 |
Pgp-inhibitor: | 1 | Pgp-substrate: | 0.002 |
Human Intestinal Absorption (HIA): | 0.296 | 20% Bioavailability (F20%): | 0.818 |
30% Bioavailability (F30%): | 0.89 |
Blood-Brain-Barrier Penetration (BBB): | 0.94 | Plasma Protein Binding (PPB): | 84.32% |
Volume Distribution (VD): | 1.39 | Fu: | 15.11% |
CYP1A2-inhibitor: | 0.034 | CYP1A2-substrate: | 0.151 |
CYP2C19-inhibitor: | 0.876 | CYP2C19-substrate: | 0.93 |
CYP2C9-inhibitor: | 0.942 | CYP2C9-substrate: | 0.321 |
CYP2D6-inhibitor: | 0.16 | CYP2D6-substrate: | 0.25 |
CYP3A4-inhibitor: | 0.943 | CYP3A4-substrate: | 0.886 |
Clearance (CL): | 6.503 | Half-life (T1/2): | 0.892 |
hERG Blockers: | 0.145 | Human Hepatotoxicity (H-HT): | 0.628 |
Drug-inuced Liver Injury (DILI): | 0.819 | AMES Toxicity: | 0.546 |
Rat Oral Acute Toxicity: | 0.452 | Maximum Recommended Daily Dose: | 0.769 |
Skin Sensitization: | 0.929 | Carcinogencity: | 0.765 |
Eye Corrosion: | 0.005 | Eye Irritation: | 0.012 |
Respiratory Toxicity: | 0.964 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005593 | ![]() |
0.458 | D0B1IP | ![]() |
0.210 | ||
ENC006052 | ![]() |
0.279 | D01KTN | ![]() |
0.196 | ||
ENC002463 | ![]() |
0.276 | D0V3YT | ![]() |
0.191 | ||
ENC001870 | ![]() |
0.264 | D01JFT | ![]() |
0.191 | ||
ENC003605 | ![]() |
0.261 | D07IQS | ![]() |
0.191 | ||
ENC005588 | ![]() |
0.261 | D0R3FP | ![]() |
0.190 | ||
ENC001266 | ![]() |
0.248 | D03SVX | ![]() |
0.189 | ||
ENC005589 | ![]() |
0.246 | D0AY7K | ![]() |
0.189 | ||
ENC003676 | ![]() |
0.237 | D0L2UN | ![]() |
0.185 | ||
ENC003394 | ![]() |
0.236 | D05QDC | ![]() |
0.184 |