![]() |
Name |
Isochromophilone IX
|
Molecular Formula | C25H30ClNO6 | |
IUPAC Name* |
4-[7-acetyloxy-5-chloro-3-[(1E,3E)-3,5-dimethylhepta-1,3-dienyl]-7-methyl-6,8-dioxoisoquinolin-2-yl]butanoic acid
|
|
SMILES |
CCC(C)/C=C(\C)/C=C/C1=CC2=C(C(=O)C(C(=O)C2=CN1CCCC(=O)O)(C)OC(=O)C)Cl
|
|
InChI |
InChI=1S/C25H30ClNO6/c1-6-15(2)12-16(3)9-10-18-13-19-20(14-27(18)11-7-8-21(29)30)23(31)25(5,33-17(4)28)24(32)22(19)26/h9-10,12-15H,6-8,11H2,1-5H3,(H,29,30)/b10-9+,16-12+
|
|
InChIKey |
SAMXBYLRDCRTCV-HMSDUJDUSA-N
|
|
Synonyms |
Isochromophilone IX; 634920-03-9; ACon1_000757; DTXSID001346899; NCGC00169389-01; NCGC00169389-03; BRD-A46352604-001-01-6; NCGC00169389-03_C25H30ClNO6_2(6H)-Isoquinolinebutanoic acid, 7-(acetyloxy)-5-chloro-3-[(1E,3E)-3,5-dimethyl-1,3-heptadien-1-yl]-7,8-dihydro-7-methyl-6,8-dioxo-
|
|
CAS | 634920-03-9 | |
PubChem CID | 23789027 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 476.0 | ALogp: | 4.8 |
HBD: | 1 | HBA: | 7 |
Rotatable Bonds: | 10 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 101.0 | Aromatic Rings: | 2 |
Heavy Atoms: | 33 | QED Weighted: | 0.286 |
Caco-2 Permeability: | -5.17 | MDCK Permeability: | 0.00002720 |
Pgp-inhibitor: | 0.006 | Pgp-substrate: | 0.002 |
Human Intestinal Absorption (HIA): | 0.008 | 20% Bioavailability (F20%): | 0.002 |
30% Bioavailability (F30%): | 0.002 |
Blood-Brain-Barrier Penetration (BBB): | 0.099 | Plasma Protein Binding (PPB): | 90.27% |
Volume Distribution (VD): | 0.482 | Fu: | 12.10% |
CYP1A2-inhibitor: | 0.212 | CYP1A2-substrate: | 0.172 |
CYP2C19-inhibitor: | 0.202 | CYP2C19-substrate: | 0.826 |
CYP2C9-inhibitor: | 0.692 | CYP2C9-substrate: | 0.989 |
CYP2D6-inhibitor: | 0.291 | CYP2D6-substrate: | 0.201 |
CYP3A4-inhibitor: | 0.534 | CYP3A4-substrate: | 0.371 |
Clearance (CL): | 1.123 | Half-life (T1/2): | 0.919 |
hERG Blockers: | 0.008 | Human Hepatotoxicity (H-HT): | 0.815 |
Drug-inuced Liver Injury (DILI): | 0.982 | AMES Toxicity: | 0.07 |
Rat Oral Acute Toxicity: | 0.276 | Maximum Recommended Daily Dose: | 0.861 |
Skin Sensitization: | 0.554 | Carcinogencity: | 0.8 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.01 |
Respiratory Toxicity: | 0.794 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC006052 | ![]() |
0.848 | D0WY9N | ![]() |
0.231 | ||
ENC001870 | ![]() |
0.826 | D05QDC | ![]() |
0.226 | ||
ENC006053 | ![]() |
0.787 | D06BLQ | ![]() |
0.216 | ||
ENC003605 | ![]() |
0.752 | D0B1IP | ![]() |
0.215 | ||
ENC003676 | ![]() |
0.698 | D00DKK | ![]() |
0.205 | ||
ENC006054 | ![]() |
0.633 | D0G3PI | ![]() |
0.205 | ||
ENC001841 | ![]() |
0.633 | D02DGU | ![]() |
0.205 | ||
ENC003626 | ![]() |
0.596 | D0HD9K | ![]() |
0.205 | ||
ENC005593 | ![]() |
0.542 | D09QEI | ![]() |
0.203 | ||
ENC004762 | ![]() |
0.529 | D0UU9Y | ![]() |
0.203 |