![]() |
Name |
12-hydroxylmycoepoxydiene
|
Molecular Formula | C17H20O6 | |
IUPAC Name* |
[2-(1-hydroxy-7,8-dimethyl-9-oxabicyclo[4.2.1]nona-2,4-dien-7-yl)-6-oxo-2,3-dihydropyran-3-yl]acetate
|
|
SMILES |
CC(=O)OC1C=CC(=O)OC1C1(C)C2C=CC=CC(O)(O2)C1C
|
|
InChI |
InChI=1S/C17H20O6/c1-10-16(3,13-6-4-5-9-17(10,20)23-13)15-12(21-11(2)18)7-8-14(19)22-15/h4-10,12-13,15,20H,1-3H3/t10-,12-,13-,15+,16+,17+/m0/s1
|
|
InChIKey |
YFFBQEQVDARDFO-GAGDYANQSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 320.34 | ALogp: | 1.3 |
HBD: | 1 | HBA: | 6 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 82.1 | Aromatic Rings: | 3 |
Heavy Atoms: | 23 | QED Weighted: | 0.78 |
Caco-2 Permeability: | -4.673 | MDCK Permeability: | 0.00001370 |
Pgp-inhibitor: | 0.991 | Pgp-substrate: | 0.014 |
Human Intestinal Absorption (HIA): | 0.026 | 20% Bioavailability (F20%): | 0.947 |
30% Bioavailability (F30%): | 0.06 |
Blood-Brain-Barrier Penetration (BBB): | 0.994 | Plasma Protein Binding (PPB): | 25.07% |
Volume Distribution (VD): | 0.857 | Fu: | 67.88% |
CYP1A2-inhibitor: | 0.008 | CYP1A2-substrate: | 0.079 |
CYP2C19-inhibitor: | 0.021 | CYP2C19-substrate: | 0.244 |
CYP2C9-inhibitor: | 0.022 | CYP2C9-substrate: | 0.051 |
CYP2D6-inhibitor: | 0.003 | CYP2D6-substrate: | 0.121 |
CYP3A4-inhibitor: | 0.188 | CYP3A4-substrate: | 0.526 |
Clearance (CL): | 6.633 | Half-life (T1/2): | 0.67 |
hERG Blockers: | 0.062 | Human Hepatotoxicity (H-HT): | 0.269 |
Drug-inuced Liver Injury (DILI): | 0.022 | AMES Toxicity: | 0.628 |
Rat Oral Acute Toxicity: | 0.556 | Maximum Recommended Daily Dose: | 0.953 |
Skin Sensitization: | 0.931 | Carcinogencity: | 0.105 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.02 |
Respiratory Toxicity: | 0.766 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002139 | ![]() |
0.470 | D0T6WT | ![]() |
0.275 | ||
ENC003827 | ![]() |
0.380 | D02FEM | ![]() |
0.229 | ||
ENC003825 | ![]() |
0.380 | D0P0HT | ![]() |
0.227 | ||
ENC003826 | ![]() |
0.380 | D09WYX | ![]() |
0.218 | ||
ENC002498 | ![]() |
0.333 | D03ZZK | ![]() |
0.217 | ||
ENC003704 | ![]() |
0.326 | D08PIQ | ![]() |
0.214 | ||
ENC003105 | ![]() |
0.326 | D0I5DS | ![]() |
0.214 | ||
ENC002503 | ![]() |
0.302 | D03IKT | ![]() |
0.211 | ||
ENC005754 | ![]() |
0.300 | D0FL5V | ![]() |
0.211 | ||
ENC003465 | ![]() |
0.299 | D03HYX | ![]() |
0.211 |