![]() |
Name |
11S-Hydroxy-1-methoxyfusaricide
|
Molecular Formula | C18H27NO4 | |
IUPAC Name* |
6-ethyl-7-hydroxy-2-methoxy-6a,8,10-trimethyl-6,7,8,9,10,10a-hexahydroisochromeno[4,3-c]pyridin-1-one
|
|
SMILES |
CCC1Oc2ccn(OC)c(=O)c2C2C(C)CC(C)C(O)C12C
|
|
InChI |
InChI=1S/C18H27NO4/c1-6-13-18(4)15(10(2)9-11(3)16(18)20)14-12(23-13)7-8-19(22-5)17(14)21/h7-8,10-11,13,15-16,20H,6,9H2,1-5H3/t10-,11+,13-,15-,16-,18-/m0/s1
|
|
InChIKey |
YFWSQAOPIPQBDD-DAIXFQOZSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 321.42 | ALogp: | 2.2 |
HBD: | 1 | HBA: | 5 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 60.7 | Aromatic Rings: | 3 |
Heavy Atoms: | 23 | QED Weighted: | 0.91 |
Caco-2 Permeability: | -4.624 | MDCK Permeability: | 0.00001600 |
Pgp-inhibitor: | 0.317 | Pgp-substrate: | 0.022 |
Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.009 |
30% Bioavailability (F30%): | 0.603 |
Blood-Brain-Barrier Penetration (BBB): | 0.916 | Plasma Protein Binding (PPB): | 82.77% |
Volume Distribution (VD): | 0.784 | Fu: | 15.15% |
CYP1A2-inhibitor: | 0.055 | CYP1A2-substrate: | 0.905 |
CYP2C19-inhibitor: | 0.064 | CYP2C19-substrate: | 0.94 |
CYP2C9-inhibitor: | 0.152 | CYP2C9-substrate: | 0.569 |
CYP2D6-inhibitor: | 0.005 | CYP2D6-substrate: | 0.716 |
CYP3A4-inhibitor: | 0.318 | CYP3A4-substrate: | 0.708 |
Clearance (CL): | 12.058 | Half-life (T1/2): | 0.092 |
hERG Blockers: | 0.012 | Human Hepatotoxicity (H-HT): | 0.44 |
Drug-inuced Liver Injury (DILI): | 0.288 | AMES Toxicity: | 0.068 |
Rat Oral Acute Toxicity: | 0.279 | Maximum Recommended Daily Dose: | 0.325 |
Skin Sensitization: | 0.02 | Carcinogencity: | 0.032 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.01 |
Respiratory Toxicity: | 0.847 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005993 | ![]() |
0.587 | D0H0ND | ![]() |
0.231 | ||
ENC004010 | ![]() |
0.500 | D0D2TN | ![]() |
0.227 | ||
ENC005574 | ![]() |
0.380 | D06WTZ | ![]() |
0.224 | ||
ENC005575 | ![]() |
0.373 | D0E9KA | ![]() |
0.220 | ||
ENC005193 | ![]() |
0.330 | D09WYX | ![]() |
0.210 | ||
ENC004878 | ![]() |
0.291 | D0K7LU | ![]() |
0.207 | ||
ENC004872 | ![]() |
0.279 | D0CZ1Q | ![]() |
0.205 | ||
ENC004394 | ![]() |
0.278 | D0L7AS | ![]() |
0.204 | ||
ENC003969 | ![]() |
0.278 | D03DIG | ![]() |
0.202 | ||
ENC005841 | ![]() |
0.278 | D0T6RC | ![]() |
0.202 |