![]() |
Name |
(2R*,4R*)-3,4-dihydro-5-methoxy-2-methyl-2H-1-benzopyran-4-OL
|
Molecular Formula | C11H14O3 | |
IUPAC Name* |
(2R,4R)-5-methoxy-2-methyl-3,4-dihydro-2H-chromen-4-ol
|
|
SMILES |
C[C@@H]1C[C@H](C2=C(O1)C=CC=C2OC)O
|
|
InChI |
InChI=1S/C11H14O3/c1-7-6-8(12)11-9(13-2)4-3-5-10(11)14-7/h3-5,7-8,12H,6H2,1-2H3/t7-,8-/m1/s1
|
|
InChIKey |
IKMJJUOTBFIXHX-HTQZYQBOSA-N
|
|
Synonyms |
(2R*,4R*)-3,4-dihydro-5-methoxy-2-methyl-2H-1-benzopyran-4-OL
|
|
CAS | NA | |
PubChem CID | 139591578 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 194.23 | ALogp: | 1.6 |
HBD: | 1 | HBA: | 3 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 38.7 | Aromatic Rings: | 2 |
Heavy Atoms: | 14 | QED Weighted: | 0.746 |
Caco-2 Permeability: | -4.708 | MDCK Permeability: | 0.00001770 |
Pgp-inhibitor: | 0.004 | Pgp-substrate: | 0.02 |
Human Intestinal Absorption (HIA): | 0.003 | 20% Bioavailability (F20%): | 0.001 |
30% Bioavailability (F30%): | 0.002 |
Blood-Brain-Barrier Penetration (BBB): | 0.94 | Plasma Protein Binding (PPB): | 66.08% |
Volume Distribution (VD): | 1.93 | Fu: | 24.26% |
CYP1A2-inhibitor: | 0.725 | CYP1A2-substrate: | 0.777 |
CYP2C19-inhibitor: | 0.725 | CYP2C19-substrate: | 0.867 |
CYP2C9-inhibitor: | 0.182 | CYP2C9-substrate: | 0.928 |
CYP2D6-inhibitor: | 0.042 | CYP2D6-substrate: | 0.856 |
CYP3A4-inhibitor: | 0.073 | CYP3A4-substrate: | 0.468 |
Clearance (CL): | 7.152 | Half-life (T1/2): | 0.464 |
hERG Blockers: | 0.039 | Human Hepatotoxicity (H-HT): | 0.512 |
Drug-inuced Liver Injury (DILI): | 0.333 | AMES Toxicity: | 0.146 |
Rat Oral Acute Toxicity: | 0.278 | Maximum Recommended Daily Dose: | 0.971 |
Skin Sensitization: | 0.247 | Carcinogencity: | 0.524 |
Eye Corrosion: | 0.011 | Eye Irritation: | 0.929 |
Respiratory Toxicity: | 0.74 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
![]() |
D0R9VR | ![]() |
0.303 | ||||
![]() |
D0E9CD | ![]() |
0.278 | ||||
![]() |
D03DIG | ![]() |
0.275 | ||||
![]() |
D0T6RC | ![]() |
0.259 | ||||
![]() |
D09GYT | ![]() |
0.254 | ||||
![]() |
D05SHK | ![]() |
0.253 | ||||
![]() |
D08CCE | ![]() |
0.253 | ||||
![]() |
D07MGA | ![]() |
0.250 | ||||
![]() |
D0Q5MQ | ![]() |
0.247 | ||||
![]() |
D0L1WV | ![]() |
0.239 |