![]() |
Name |
1β-hydroxy momilactone A
|
Molecular Formula | C20H26O4 | |
IUPAC Name* |
5-ethenyl-15-hydroxy-1,5,12-trimethyl-10-oxatetracyclo[7.6.1.02,7.012,16]hexadec-7-ene-11,13-dione
|
|
SMILES |
C=CC1(C)CCC2C(=CC3OC(=O)C4(C)C(=O)CC(O)C2(C)C34)C1
|
|
InChI |
InChI=1S/C20H26O4/c1-5-18(2)7-6-12-11(10-18)8-13-16-19(12,3)14(21)9-15(22)20(16,4)17(23)24-13/h5,8,12-14,16,21H,1,6-7,9-10H2,2-4H3/t12-,13-,14-,16-,18-,19+,20+/m1/s1
|
|
InChIKey |
NVSXVFUZBHZDDM-ZIHBBDEJSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 330.42 | ALogp: | 2.8 |
HBD: | 1 | HBA: | 4 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 63.6 | Aromatic Rings: | 4 |
Heavy Atoms: | 24 | QED Weighted: | 0.453 |
Caco-2 Permeability: | -4.83 | MDCK Permeability: | 0.00002740 |
Pgp-inhibitor: | 0.574 | Pgp-substrate: | 0.042 |
Human Intestinal Absorption (HIA): | 0.105 | 20% Bioavailability (F20%): | 0.126 |
30% Bioavailability (F30%): | 0.005 |
Blood-Brain-Barrier Penetration (BBB): | 0.985 | Plasma Protein Binding (PPB): | 60.79% |
Volume Distribution (VD): | 0.816 | Fu: | 42.40% |
CYP1A2-inhibitor: | 0.014 | CYP1A2-substrate: | 0.674 |
CYP2C19-inhibitor: | 0.065 | CYP2C19-substrate: | 0.837 |
CYP2C9-inhibitor: | 0.044 | CYP2C9-substrate: | 0.17 |
CYP2D6-inhibitor: | 0.011 | CYP2D6-substrate: | 0.185 |
CYP3A4-inhibitor: | 0.895 | CYP3A4-substrate: | 0.58 |
Clearance (CL): | 10.238 | Half-life (T1/2): | 0.11 |
hERG Blockers: | 0.001 | Human Hepatotoxicity (H-HT): | 0.073 |
Drug-inuced Liver Injury (DILI): | 0.137 | AMES Toxicity: | 0.044 |
Rat Oral Acute Toxicity: | 0.817 | Maximum Recommended Daily Dose: | 0.397 |
Skin Sensitization: | 0.017 | Carcinogencity: | 0.461 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.015 |
Respiratory Toxicity: | 0.965 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003257 | ![]() |
0.390 | D0G6AB | ![]() |
0.283 | ||
ENC002056 | ![]() |
0.360 | D0D2VS | ![]() |
0.260 | ||
ENC002832 | ![]() |
0.347 | D0H2MO | ![]() |
0.260 | ||
ENC003406 | ![]() |
0.337 | D0Q6NZ | ![]() |
0.260 | ||
ENC001297 | ![]() |
0.329 | D04VIS | ![]() |
0.255 | ||
ENC001409 | ![]() |
0.327 | D0H1QY | ![]() |
0.253 | ||
ENC002903 | ![]() |
0.323 | D0K0EK | ![]() |
0.253 | ||
ENC002007 | ![]() |
0.320 | D0G8BV | ![]() |
0.252 | ||
ENC002394 | ![]() |
0.315 | D0W2EK | ![]() |
0.252 | ||
ENC001928 | ![]() |
0.315 | D0L2LS | ![]() |
0.250 |