|
Name |
9-deoxyhymatoxin A
|
Molecular Formula | C20H30O6S | |
IUPAC Name* |
2-[(1R,2S,5S,9R,12S,16R)-1,5,12-trimethyl-11-oxo-10-oxatetracyclo[7.6.1.02,7.012,16]hexadec-7-en-5-yl]ethyl hydrogen sulfate
|
|
SMILES |
C[C@@]1(CC[C@H]2C(=C[C@@H]3[C@@H]4[C@@]2(CCC[C@@]4(C(=O)O3)C)C)C1)CCOS(=O)(=O)O
|
|
InChI |
InChI=1S/C20H30O6S/c1-18(9-10-25-27(22,23)24)8-5-14-13(12-18)11-15-16-19(14,2)6-4-7-20(16,3)17(21)26-15/h11,14-16H,4-10,12H2,1-3H3,(H,22,23,24)/t14-,15+,16+,18+,19+,20-/m0/s1
|
|
InChIKey |
ZRFMKYKOLFQQPF-QWFGBESBSA-N
|
|
Synonyms |
9-deoxyhymatoxin A; 9-deoxy-hymatoxin A; (-)-9-deoxyhymatoxin A; (-)-9-deoxy-hymatoxin A; CHEBI:141328; (6beta,13alpha)-18-oxo-6,18-epoxypimar-7-en-16-yl hydrogen sulfate; (1S)-10beta-Hydroxy-7alpha-[2-(sulfooxy)ethyl]-1,4abeta,7-trimethyl-1,2,3,4,4a,4balpha,5,6,7,8,10,10aalpha-dodecahydrophenanthrene-1beta-carboxylic acid 1,10-lactone
|
|
CAS | NA | |
PubChem CID | 102357824 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 398.5 | ALogp: | 3.5 |
HBD: | 1 | HBA: | 6 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 98.3 | Aromatic Rings: | 4 |
Heavy Atoms: | 27 | QED Weighted: | 0.429 |
Caco-2 Permeability: | -5.327 | MDCK Permeability: | 0.00001460 |
Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.475 | 20% Bioavailability (F20%): | 0.998 |
30% Bioavailability (F30%): | 0.951 |
Blood-Brain-Barrier Penetration (BBB): | 0.053 | Plasma Protein Binding (PPB): | 88.65% |
Volume Distribution (VD): | 0.807 | Fu: | 4.99% |
CYP1A2-inhibitor: | 0.009 | CYP1A2-substrate: | 0.955 |
CYP2C19-inhibitor: | 0.019 | CYP2C19-substrate: | 0.78 |
CYP2C9-inhibitor: | 0.077 | CYP2C9-substrate: | 0.084 |
CYP2D6-inhibitor: | 0.004 | CYP2D6-substrate: | 0.101 |
CYP3A4-inhibitor: | 0.334 | CYP3A4-substrate: | 0.117 |
Clearance (CL): | 1.766 | Half-life (T1/2): | 0.079 |
hERG Blockers: | 0.021 | Human Hepatotoxicity (H-HT): | 0.453 |
Drug-inuced Liver Injury (DILI): | 0.069 | AMES Toxicity: | 0.156 |
Rat Oral Acute Toxicity: | 0.518 | Maximum Recommended Daily Dose: | 0.864 |
Skin Sensitization: | 0.202 | Carcinogencity: | 0.4 |
Eye Corrosion: | 0.006 | Eye Irritation: | 0.026 |
Respiratory Toxicity: | 0.979 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003258 | 0.614 | D01CKY | 0.277 | ||||
ENC002056 | 0.408 | D0Z1XD | 0.274 | ||||
ENC005049 | 0.390 | D08TEJ | 0.273 | ||||
ENC005750 | 0.376 | D04GJN | 0.268 | ||||
ENC005747 | 0.370 | D0X4RS | 0.264 | ||||
ENC005256 | 0.368 | D0IX6I | 0.261 | ||||
ENC005748 | 0.363 | D0I2SD | 0.257 | ||||
ENC005203 | 0.354 | D0T0LU | 0.257 | ||||
ENC002394 | 0.354 | D02CJX | 0.252 | ||||
ENC001928 | 0.354 | D0U3GL | 0.250 |